EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30N2O6S |
| Net Charge | 0 |
| Average Mass | 510.612 |
| Monoisotopic Mass | 510.18246 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)Oc3cccc(COC(=O)C(C)C)c3)N1C(=O)[C@H]2NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C27H30N2O6S/c1-16(2)25(32)34-15-18-11-8-12-19(13-18)35-26(33)22-27(3,4)36-24-21(23(31)29(22)24)28-20(30)14-17-9-6-5-7-10-17/h5-13,16,21-22,24H,14-15H2,1-4H3,(H,28,30)/t21-,22+,24-/m1/s1 |
| InChIKey | MGKUHWMKIYHWOJ-AOHZBQACSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tobicillin (CHEBI:32235) is a penicillin (CHEBI:17334) |
| Synonym | Source |
|---|---|
| Tobicillin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D01214 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:151287-22-8 | KEGG COMPOUND |