EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C19H22NO4S2.H2O |
| Net Charge | 0 |
| Average Mass | 490.441 |
| Monoisotopic Mass | 489.02793 |
| SMILES | O.[Br-].[H][C@]12C[C@H](OC(=O)C(O)(c3cccs3)c3cccs3)C[C@]([H])([C@H]3O[C@H]31)[N+]2(C)C |
| InChI | InChI=1S/C19H22NO4S2.BrH.H2O/c1-20(2)12-9-11(10-13(20)17-16(12)24-17)23-18(21)19(22,14-5-3-7-25-14)15-6-4-8-26-15;;/h3-8,11-13,16-17,22H,9-10H2,1-2H3;1H;1H2/q+1;;/p-1/t11-,12-,13+,16-,17+;; |
| InChIKey | MQLXPRBEAHBZTK-SEINRUQRSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tiotropium bromide hydrate (CHEBI:32230) has role bronchodilator agent (CHEBI:35523) |
| tiotropium bromide hydrate (CHEBI:32230) has role muscarinic antagonist (CHEBI:48876) |
| tiotropium bromide hydrate (CHEBI:32230) is a hydrate (CHEBI:35505) |
| Incoming Relation(s) |
| Stiolto Respimat (CHEBI:90958) has part tiotropium bromide hydrate (CHEBI:32230) |
| Synonyms | Source |
|---|---|
| (1α,2β,4β,5α,7β)-7-[(hydroxydi-2-thienylacetyl)oxy]-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonane bromide—water (1/1) | IUPAC |
| 6beta,7beta-Epoxy-3beta-hydroxy-8-methyl-1alphaH,5alphaH-tropanium bromide, di-2-thienylglycolate | ChemIDplus |
| Tiotropium bromide monohydrate | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D01929 | KEGG DRUG |
| Tiotropium_bromide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13952485 | Reaxys |
| CAS:411207-31-3 | ChemIDplus |
| CAS:411207-31-3 | KEGG DRUG |
| Citations |
|---|