EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3S |
| Net Charge | 0 |
| Average Mass | 163.198 |
| Monoisotopic Mass | 163.03031 |
| SMILES | CC(S)C(=O)NCC(=O)O |
| InChI | InChI=1S/C5H9NO3S/c1-3(10)5(9)6-2-4(7)8/h3,10H,2H2,1H3,(H,6,9)(H,7,8) |
| InChIKey | YTGJWQPHMWSCST-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tiopronin (CHEBI:32229) is a N-acyl-amino acid (CHEBI:51569) |
| INN | Source |
|---|---|
| tiopronina | WHO MedNet |
| Synonyms | Source |
|---|---|
| acadione | DrugCentral |
| alpha-Mercaptopropionylglycine | DrugCentral |
| capen | DrugCentral |
| captimer | DrugCentral |
| hepadigest | DrugCentral |
| mercaptopropionylglycine | DrugCentral |
| Brand Names | Source |
|---|---|
| Thiola | ChEMBL |
| Thiola ec | ChEMBL |
| Citations |
|---|