EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O2 |
| Net Charge | 0 |
| Average Mass | 312.453 |
| Monoisotopic Mass | 312.20893 |
| SMILES | [H][C@@]12CC[C@@](O)(C#C)[C@@]1(C)CC[C@]1([H])C3=C(CC(=O)CC3)C[C@@H](C)[C@@]21[H] |
| InChI | InChI=1S/C21H28O2/c1-4-21(23)10-8-18-19-13(2)11-14-12-15(22)5-6-16(14)17(19)7-9-20(18,21)3/h1,13,17-19,23H,5-12H2,2-3H3/t13-,17-,18+,19-,20+,21+/m1/s1 |
| InChIKey | WZDGZWOAQTVYBX-XOINTXKNSA-N |
| Roles Classification |
|---|
| Biological Role: | hormone agonist A chemical substance which binds to specific hormone receptors activating the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. |
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. hormone agonist A chemical substance which binds to specific hormone receptors activating the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tibolone (CHEBI:32223) has role bone density conservation agent (CHEBI:50646) |
| tibolone (CHEBI:32223) has role hormone agonist (CHEBI:51060) |
| tibolone (CHEBI:32223) is a 17β-hydroxy steroid (CHEBI:35343) |
| tibolone (CHEBI:32223) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| 17α-ethynyl-17β-hydroxy-7α-methylestr-5(10)-en-3-one |
| INNs | Source |
|---|---|
| tibolona | ChemIDplus |
| tibolone | ChemIDplus |
| tibolonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 17-hydroxy-7α-methyl-19-nor-17α-pregn-5(10)-en-20-yn-3-one | ChemIDplus |
| (17R)-17-hydroxy-7α-methyl-19-norpregn-5(10)-en-20-yn-3-one | ChEBI |
| (7α,17α)-17-hydroxy-7-methyl-19-norpregn-5(10)-en-20-yn-3-one | ChEBI |
| (7α,17β)-17-ethynyl-17-hydroxy-7-methylestr-5(10)en-3-one | ChEBI |