EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O2 |
| Net Charge | 0 |
| Average Mass | 312.453 |
| Monoisotopic Mass | 312.20893 |
| SMILES | [H][C@@]12CC[C@@](O)(C#C)[C@@]1(C)CC[C@]1([H])C3=C(CC(=O)CC3)C[C@@H](C)[C@@]21[H] |
| InChI | InChI=1S/C21H28O2/c1-4-21(23)10-8-18-19-13(2)11-14-12-15(22)5-6-16(14)17(19)7-9-20(18,21)3/h1,13,17-19,23H,5-12H2,2-3H3/t13-,17-,18+,19-,20+,21+/m1/s1 |
| InChIKey | WZDGZWOAQTVYBX-XOINTXKNSA-N |
| Roles Classification |
|---|
| Biological Role: | hormone agonist A chemical substance which binds to specific hormone receptors activating the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. hormone agonist A chemical substance which binds to specific hormone receptors activating the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tibolone (CHEBI:32223) has role antidepressant (CHEBI:35469) |
| tibolone (CHEBI:32223) has role antineoplastic agent (CHEBI:35610) |
| tibolone (CHEBI:32223) has role bone density conservation agent (CHEBI:50646) |
| tibolone (CHEBI:32223) has role hormone agonist (CHEBI:51060) |
| tibolone (CHEBI:32223) is a 17β-hydroxy steroid (CHEBI:35343) |
| tibolone (CHEBI:32223) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| 17α-ethynyl-17β-hydroxy-7α-methylestr-5(10)-en-3-one |
| INNs | Source |
|---|---|
| tibolona | ChemIDplus |
| tibolone | ChemIDplus |
| tibolonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 17-hydroxy-7α-methyl-19-nor-17α-pregn-5(10)-en-20-yn-3-one | ChemIDplus |
| (17R)-17-hydroxy-7α-methyl-19-norpregn-5(10)-en-20-yn-3-one | ChEBI |
| (7α,17α)-17-hydroxy-7-methyl-19-norpregn-5(10)-en-20-yn-3-one | ChEBI |
| (7α,17β)-17-ethynyl-17-hydroxy-7-methylestr-5(10)en-3-one | ChEBI |
| NSC-759898 | ChEMBL |
| ORG OD 14 | ChEMBL |
| Brand Name | Source |
|---|---|
| Livial | ChEMBL |
| Citations |
|---|