EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O2 |
| Net Charge | 0 |
| Average Mass | 312.453 |
| Monoisotopic Mass | 312.20893 |
| SMILES | [H][C@@]12CC[C@@](O)(C#C)[C@@]1(C)CC[C@]1([H])C3=C(CC(=O)CC3)C[C@@H](C)[C@@]21[H] |
| InChI | InChI=1S/C21H28O2/c1-4-21(23)10-8-18-19-13(2)11-14-12-15(22)5-6-16(14)17(19)7-9-20(18,21)3/h1,13,17-19,23H,5-12H2,2-3H3/t13-,17-,18+,19-,20+,21+/m1/s1 |
| InChIKey | WZDGZWOAQTVYBX-XOINTXKNSA-N |
| Roles Classification |
|---|
| Biological Role: | hormone agonist A chemical substance which binds to specific hormone receptors activating the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. |
| Applications: | hormone agonist A chemical substance which binds to specific hormone receptors activating the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tibolone (CHEBI:32223) has role bone density conservation agent (CHEBI:50646) |
| tibolone (CHEBI:32223) has role hormone agonist (CHEBI:51060) |
| tibolone (CHEBI:32223) is a 17β-hydroxy steroid (CHEBI:35343) |
| tibolone (CHEBI:32223) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| 17α-ethynyl-17β-hydroxy-7α-methylestr-5(10)-en-3-one |
| INNs | Source |
|---|---|
| tibolone | ChemIDplus |
| tibolona | ChemIDplus |
| tibolonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 17-hydroxy-7α-methyl-19-nor-17α-pregn-5(10)-en-20-yn-3-one | ChemIDplus |
| (7α,17α)-17-hydroxy-7-methyl-19-norpregn-5(10)-en-20-yn-3-one | ChEBI |
| (17R)-17-hydroxy-7α-methyl-19-norpregn-5(10)-en-20-yn-3-one | ChEBI |
| (7α,17β)-17-ethynyl-17-hydroxy-7-methylestr-5(10)en-3-one | ChEBI |