EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O6 |
| Net Charge | 0 |
| Average Mass | 386.444 |
| Monoisotopic Mass | 386.17294 |
| SMILES | COc1cc(C[C@@H]2COC[C@H]2Cc2ccc3c(c2)OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C22H26O6/c1-23-20-9-15(10-21(24-2)22(20)25-3)7-17-12-26-11-16(17)6-14-4-5-18-19(8-14)28-13-27-18/h4-5,8-10,16-17H,6-7,11-13H2,1-3H3/t16-,17-/m1/s1 |
| InChIKey | VJMJISPSGHVBBU-IAGOWNOFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| burseran (CHEBI:3222) has role antineoplastic agent (CHEBI:35610) |
| burseran (CHEBI:3222) has role metabolite (CHEBI:25212) |
| burseran (CHEBI:3222) is a benzodioxoles (CHEBI:38298) |
| burseran (CHEBI:3222) is a cyclic acetal (CHEBI:59770) |
| burseran (CHEBI:3222) is a lignan (CHEBI:25036) |
| burseran (CHEBI:3222) is a methoxybenzenes (CHEBI:51683) |
| IUPAC Name |
|---|
| 5-{[(3S,4S)-4-(3,4,5-trimethoxybenzyl)tetrahydrofuran-3-yl]methyl}-1,3-benzodioxole |
| Synonyms | Source |
|---|---|
| (+)-Burseran | KEGG COMPOUND |
| (+)-Burseran | ChEBI |
| Citations |
|---|