EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16O7 |
| Net Charge | 0 |
| Average Mass | 356.330 |
| Monoisotopic Mass | 356.08960 |
| SMILES | CC1(O)CC(O)Cc2cc3c(c(O)c21)C(=O)c1c(O)cc(O)cc1C3=O |
| InChI | InChI=1S/C19H16O7/c1-19(26)6-9(21)2-7-3-10-14(18(25)15(7)19)17(24)13-11(16(10)23)4-8(20)5-12(13)22/h3-5,9,20-22,25-26H,2,6H2,1H3 |
| InChIKey | WBICYHCOBLVBMM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetracenomycin M (CHEBI:32208) is a tetracenomycin (CHEBI:48132) |
| IUPAC Name |
|---|
| 1,3,8,10,11-pentahydroxy-10-methyl-7,8,9,10-tetrahydrotetracene-5,12-dione |
| Synonym | Source |
|---|---|
| Tetracenomycin M | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C12372 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7778342 | Beilstein |