EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H16O8 |
| Net Charge | 0 |
| Average Mass | 408.362 |
| Monoisotopic Mass | 408.08452 |
| SMILES | COc1cc(O)c2c(c1)C(=O)c1cc3cc(OC)c(C(=O)O)c(C)c3c(O)c1C2=O |
| InChI | InChI=1S/C22H16O8/c1-8-15-9(5-14(30-3)16(8)22(27)28)4-11-18(20(15)25)21(26)17-12(19(11)24)6-10(29-2)7-13(17)23/h4-7,23,25H,1-3H3,(H,27,28) |
| InChIKey | UBGPMJPFKHUCCA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetracenomycin E (CHEBI:32204) is a tetracenequinones (CHEBI:51286) |
| tetracenomycin E (CHEBI:32204) is a tetracenomycin (CHEBI:48132) |
| IUPAC Name |
|---|
| 10,12-dihydroxy-3,8-dimethoxy-1-methyl-6,11-dioxo-6,11-dihydrotetracene-2-carboxylic acid |
| Synonym | Source |
|---|---|
| Tetracenomycin E | KEGG COMPOUND |