EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18ClNO.HCl |
| Net Charge | 0 |
| Average Mass | 276.207 |
| Monoisotopic Mass | 275.08437 |
| SMILES | CC(NC(C)(C)C)C(=O)c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C13H18ClNO.ClH/c1-9(15-13(2,3)4)12(16)10-6-5-7-11(14)8-10;/h5-9,15H,1-4H3;1H |
| InChIKey | HEYVINCGKDONRU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bupropion hydrochloride (CHEBI:3220) has role anti-obesity agent (CHEBI:74518) |
| Bupropion hydrochloride (CHEBI:3220) has role antidepressant (CHEBI:35469) |
| Bupropion hydrochloride (CHEBI:3220) has role antineoplastic agent (CHEBI:35610) |
| Bupropion hydrochloride (CHEBI:3220) has role antipsychotic agent (CHEBI:35476) |
| Bupropion hydrochloride (CHEBI:3220) is a aromatic ketone (CHEBI:76224) |
| Synonyms | Source |
|---|---|
| Amfebutamone hydrochloride | ChEMBL |
| Bupropion hydrochloride | KEGG COMPOUND |
| BW 323 | ChEMBL |
| BW-323 | ChEMBL |
| BW323 | ChEMBL |
| Mysimba | ChEMBL |
| Brand Names | Source |
|---|---|
| Bupropion hydrochloride component of auvelity | ChEMBL |
| Bupropion hydrochloride component of contrave | ChEMBL |
| Forfivo xl | ChEMBL |
| Wellbutrin 100 | ChEMBL |
| Wellbutrin 75 | ChEMBL |
| Wellbutrin sr | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00817 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:31677-93-7 | KEGG COMPOUND |
| Citations |
|---|