EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11N3O4S2 |
| Net Charge | 0 |
| Average Mass | 337.382 |
| Monoisotopic Mass | 337.01910 |
| SMILES | CN1C(C(=O)Nc2ccccn2)=C(O)c2sccc2S1(=O)=O |
| InChI | InChI=1S/C13H11N3O4S2/c1-16-10(13(18)15-9-4-2-3-6-14-9)11(17)12-8(5-7-21-12)22(16,19)20/h2-7,17H,1H3,(H,14,15,18) |
| InChIKey | LZNWYQJJBLGYLT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. |
| Applications: | antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tenoxicam (CHEBI:32192) has role antipyretic (CHEBI:35493) |
| tenoxicam (CHEBI:32192) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| tenoxicam (CHEBI:32192) has role non-narcotic analgesic (CHEBI:35481) |
| tenoxicam (CHEBI:32192) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| tenoxicam (CHEBI:32192) is a heteroaryl hydroxy compound (CHEBI:74818) |
| tenoxicam (CHEBI:32192) is a monocarboxylic acid amide (CHEBI:29347) |
| tenoxicam (CHEBI:32192) is a pyridines (CHEBI:26421) |
| tenoxicam (CHEBI:32192) is a thienothiazine (CHEBI:46977) |
| IUPAC Name |
|---|
| 4-hydroxy-2-methyl-N-(pyridin-2-yl)-2H-thieno[2,3-e][1,2]thiazine-3-carboxamide 1,1-dioxide |
| INNs | Source |
|---|---|
| tenoxicam | KEGG DRUG |
| tenoxicam | WHO MedNet |
| ténoxicam | WHO MedNet |
| tenoxicamum | DrugBank |
| Brand Names | Source |
|---|---|
| Mobiflex | ChEBI |
| Tilcotil | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:572193 | Reaxys |
| CAS:59804-37-4 | ChemIDplus |
| CAS:59804-37-4 | KEGG DRUG |
| Citations |
|---|