EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32188 - Tegafur
| Formula | C8H9FN2O3 |
| Net Charge | 0 |
| Average Mass | 200.169 |
| Monoisotopic Mass | 200.05972 |
| SMILES | O=c1nc(=O)n(C2CCCO2)cc1F |
| InChI | InChI=1S/C8H9FN2O3/c9-5-4-11(6-2-1-3-14-6)8(13)10-7(5)12/h4,6H,1-3H2,(H,10,12,13) |
| InChIKey | WFWLQNSHRPWKFK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tegafur (CHEBI:32188) has role antineoplastic agent (CHEBI:35610) |
| Tegafur (CHEBI:32188) has role renoprotective agent (CHEBI:231911) |
| Tegafur (CHEBI:32188) is a organohalogen compound (CHEBI:17792) |
| Tegafur (CHEBI:32188) is a pyrimidines (CHEBI:39447) |
| Synonyms | Source |
|---|---|
| Atillon | ChEMBL |
| BMS-200604 | ChEMBL |
| Coparogin | ChEMBL |
| Exonal | ChEMBL |
| Fental | ChEMBL |
| florafur | DrugCentral |
| Brand Names | Source |
|---|---|
| Citofur | ChEMBL |
| Riol | ChEMBL |
| Tegafur component of s-1 | ChEMBL |
| Tegafur component of teysuno | ChEMBL |
| Tegafur component of ts-1 | ChEMBL |
| Uftoral | ChEMBL |
| Citations |
|---|