EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21NO5 |
| Net Charge | 0 |
| Average Mass | 331.368 |
| Monoisotopic Mass | 331.14197 |
| SMILES | [H][C@]12C[C@H](OC)C=C[C@]13c1cc4c(cc1CO[C@]3(O)CN2C)OCO4 |
| InChI | InChI=1S/C18H21NO5/c1-19-9-18(20)17(4-3-12(21-2)6-16(17)19)13-7-15-14(22-10-23-15)5-11(13)8-24-18/h3-5,7,12,16,20H,6,8-10H2,1-2H3/t12-,16+,17+,18-/m1/s1 |
| InChIKey | YLWAQARRNQVEHD-PBZHRCKQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tazettine (CHEBI:32185) is a indole alkaloid (CHEBI:38958) |
| tazettine (CHEBI:32185) is a indole alkaloid fundamental parent (CHEBI:38482) |
| IUPAC Name |
|---|
| tazettine |
| Synonyms | Source |
|---|---|
| Sekisanin | ChemIDplus |
| sekisanolin | ChemIDplus |
| sekisanoline | ChemIDplus |
| Tazettine | KEGG COMPOUND |
| ungernine | ChemIDplus |