EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29N5O2.C6H8O7 |
| Net Charge | 0 |
| Average Mass | 575.619 |
| Monoisotopic Mass | 575.25913 |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.[H][C@@]12CC[C@@]([H])(C1)[C@@]1([H])C(=O)N(CCCCN3CCN(c4ncccn4)CC3)C(=O)[C@@]21[H] |
| InChI | InChI=1S/C21H29N5O2.C6H8O7/c27-19-17-15-4-5-16(14-15)18(17)20(28)26(19)9-2-1-8-24-10-12-25(13-11-24)21-22-6-3-7-23-21;7-3(8)1-6(13,5(11)12)2-4(9)10/h3,6-7,15-18H,1-2,4-5,8-14H2;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t15-,16+,17+,18-; |
| InChIKey | DMLGUJHNIWGCKM-DPFKZJTMSA-N |
| Roles Classification |
|---|
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tandospirone citrate (CHEBI:32182) has part tandospirone(1+) (CHEBI:145674) |
| tandospirone citrate (CHEBI:32182) has role antidepressant (CHEBI:35469) |
| tandospirone citrate (CHEBI:32182) has role anxiolytic drug (CHEBI:35474) |
| tandospirone citrate (CHEBI:32182) is a citrate salt (CHEBI:50744) |
| Synonyms | Source |
|---|---|
| tandospirone citrate | KEGG COMPOUND |
| SM-3997 | ChemIDplus |
| SM 3997 | KEGG COMPOUND |
| metanopirone citrate | DrugCentral |
| SM-3997 citrate | ChEBI |
| Brand Name | Source |
|---|---|
| Sediel | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D01992 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:112457-95-1 | ChemIDplus |
| Citations |
|---|