EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H42N2O11 |
| Net Charge | 0 |
| Average Mass | 666.724 |
| Monoisotopic Mass | 666.27886 |
| SMILES | CCOC(=O)Oc1c(OC)cc(C(=O)O[C@@H]2C[C@@H]3CN4CCc5c(nc6cc(OC)ccc56)[C@H]4C[C@@H]3[C@H](C(=O)OC)[C@H]2OC)cc1OC |
| InChI | InChI=1S/C35H42N2O11/c1-7-46-35(40)48-31-26(42-3)12-18(13-27(31)43-4)33(38)47-28-14-19-17-37-11-10-22-21-9-8-20(41-2)15-24(21)36-30(22)25(37)16-23(19)29(32(28)44-5)34(39)45-6/h8-9,12-13,15,19,23,25,28-29,32,36H,7,10-11,14,16-17H2,1-6H3/t19-,23+,25-,28-,29+,32+/m1/s1 |
| InChIKey | ZCDNRPPFBQDQHR-SSYATKPKSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Syrosingopine (CHEBI:32175) is a yohimban alkaloid (CHEBI:27358) |
| Synonyms | Source |
|---|---|
| Methyl 18beta-hydroxy-11,17alpha-dimethoxy-3beta,20alpha-yohimban-16beta-carboxylate 4-hydroxy | KEGG COMPOUND |
| methyl carbethoxysyringoyl reserpate | DrugCentral |
| singoserp | DrugCentral |
| Siringina (TN) | KEGG COMPOUND |
| syringopine | DrugCentral |
| syrosingopin | DrugCentral |