EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26N2O6 |
| Net Charge | 0 |
| Average Mass | 438.480 |
| Monoisotopic Mass | 438.17909 |
| SMILES | CCCCC1(COC(=O)CCC(=O)O)C(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C24H26N2O6/c1-2-3-16-24(17-32-21(29)15-14-20(27)28)22(30)25(18-10-6-4-7-11-18)26(23(24)31)19-12-8-5-9-13-19/h4-13H,2-3,14-17H2,1H3,(H,27,28) |
| InChIKey | ONWXNHPOAGOMTG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. peripheral nervous system drug A drug that acts principally at one or more sites within the peripheral neuroeffector systems, the autonomic system, and motor nerve-skeletal system. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| suxibuzone (CHEBI:32173) has role antirheumatic drug (CHEBI:35842) |
| suxibuzone (CHEBI:32173) has role non-narcotic analgesic (CHEBI:35481) |
| suxibuzone (CHEBI:32173) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| suxibuzone (CHEBI:32173) has role peripheral nervous system drug (CHEBI:49110) |
| suxibuzone (CHEBI:32173) has role prodrug (CHEBI:50266) |
| suxibuzone (CHEBI:32173) is a hemisuccinate (CHEBI:138979) |
| suxibuzone (CHEBI:32173) is a monocarboxylic acid (CHEBI:25384) |
| suxibuzone (CHEBI:32173) is a pyrazolidines (CHEBI:38312) |
| IUPAC Name |
|---|
| 4-[(4-butyl-3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)methoxy]-4-oxobutanoic acid |
| INNs | Source |
|---|---|
| suxibuzona | ChemIDplus |
| suxibuzone | WHO MedNet |
| suxibuzone | KEGG DRUG |
| suxibuzonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-Butyl-4-hydroxymethyl-1,2-diphenyl-3,5-pyrazolidinedione hydrogen succinate | ChemIDplus |
| 4-Hydroxymethylbutazolidine hemisuccinate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1815 | VSDB |
| 2547 | DrugCentral |
| D01289 | KEGG DRUG |
| HMDB0042019 | HMDB |
| LSM-5851 | LINCS |
| Suxibuzone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:904563 | Reaxys |
| CAS:27470-51-5 | KEGG DRUG |
| CAS:27470-51-5 | ChemIDplus |
| Citations |
|---|