EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N4O3S |
| Net Charge | 0 |
| Average Mass | 280.309 |
| Monoisotopic Mass | 280.06301 |
| SMILES | COc1nccnc1NS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C11H12N4O3S/c1-18-11-10(13-6-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,15) |
| InChIKey | KXRZBTAEDBELFD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfamethopyrazine (CHEBI:32162) has role antibacterial agent (CHEBI:33282) |
| sulfamethopyrazine (CHEBI:32162) has role antimalarial (CHEBI:38068) |
| sulfamethopyrazine (CHEBI:32162) is a pyrazines (CHEBI:38314) |
| sulfamethopyrazine (CHEBI:32162) is a sulfonamide (CHEBI:35358) |
| sulfamethopyrazine (CHEBI:32162) is a sulfonamide antibiotic (CHEBI:87228) |
| INN | Source |
|---|---|
| sulfaleno | WHO MedNet |
| Synonyms | Source |
|---|---|
| AS-18908 | ChEMBL |
| NSC-110433 | ChEMBL |
| sulfalene | ChEMBL |
| Sulfalene | KEGG COMPOUND |
| sulfamethopyrazine | DrugCentral |
| Sulfamethopyrazine | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Kelfizine w | ChEMBL |
| Longum | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2517 | DrugCentral |
| C12616 | KEGG COMPOUND |
| D01216 | KEGG DRUG |
| HMDB0014802 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:152-47-6 | KEGG COMPOUND |
| Citations |
|---|