EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N4O3S |
| Net Charge | 0 |
| Average Mass | 280.309 |
| Monoisotopic Mass | 280.06301 |
| SMILES | COc1nccnc1NS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C11H12N4O3S/c1-18-11-10(13-6-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,15) |
| InChIKey | KXRZBTAEDBELFD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfamethopyrazine (CHEBI:32162) is a pyrazines (CHEBI:38314) |
| sulfamethopyrazine (CHEBI:32162) is a sulfonamide (CHEBI:35358) |
| sulfamethopyrazine (CHEBI:32162) is a sulfonamide antibiotic (CHEBI:87228) |
| Synonyms | Source |
|---|---|
| Sulfamethopyrazine | KEGG COMPOUND |
| Sulfalene | KEGG COMPOUND |
| sulfapyrazinemethoxyne | DrugCentral |
| sulfamethopyrazine | DrugCentral |
| sulfapyrazinemethoxine | DrugCentral |
| sulphamethopyrazine | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| C12616 | KEGG COMPOUND |
| D01216 | KEGG DRUG |
| 2517 | DrugCentral |
| HMDB0014802 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:152-47-6 | KEGG COMPOUND |