EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H41NO4 |
| Net Charge | 0 |
| Average Mass | 467.650 |
| Monoisotopic Mass | 467.30356 |
| SMILES | [H][C@]1([C@](C)(O)C(C)(C)C)C[C@@]23CC[C@]1(OC)[C@@H]1Oc4c(O)ccc5c4[C@@]12CCN(CC1CC1)[C@@H]3C5 |
| InChI | InChI=1S/C29H41NO4/c1-25(2,3)26(4,32)20-15-27-10-11-29(20,33-5)24-28(27)12-13-30(16-17-6-7-17)21(27)14-18-8-9-19(31)23(34-24)22(18)28/h8-9,17,20-21,24,31-32H,6-7,10-16H2,1-5H3/t20-,21-,24-,26+,27-,28+,29-/m1/s1 |
| InChIKey | RMRJXGBAOAMLHD-IHFGGWKQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | delta-opioid receptor antagonist Any compound that exhibits antagonist activity at the δ-opioid receptor. kappa-opioid receptor antagonist Any compound that exhibits antagonist activity at the κ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | delta-opioid receptor antagonist Any compound that exhibits antagonist activity at the δ-opioid receptor. kappa-opioid receptor antagonist Any compound that exhibits antagonist activity at the κ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| buprenorphine (CHEBI:3216) has role opioid analgesic (CHEBI:35482) |
| buprenorphine (CHEBI:3216) has role δ-opioid receptor antagonist (CHEBI:59283) |
| buprenorphine (CHEBI:3216) has role κ-opioid receptor antagonist (CHEBI:167165) |
| buprenorphine (CHEBI:3216) has role μ-opioid receptor agonist (CHEBI:55322) |
| buprenorphine (CHEBI:3216) is a morphinane alkaloid (CHEBI:25418) |
| Incoming Relation(s) |
| buprenorphine hydrochloride (CHEBI:652822) has part buprenorphine (CHEBI:3216) |
| IUPAC Name |
|---|
| (5α,6β,14β,18R)-17-(cyclopropylmethyl)-18-[(2S)-2-hydroxy-3,3-dimethylbutan-2-yl]-6-methoxy-18,19-dihydro-4,5-epoxy-6,14-ethenomorphinan-3-ol |
| INNs | Source |
|---|---|
| buprenorfina | ChemIDplus |
| buprenorphine | ChemIDplus |
| buprenorphinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 17-cyclopropylmethyl-4,5α-epoxy-7α-((S)-1-hydroxy-1,2,2-trimethylpropyl)-6-methoxy-6,14-endo-ethanomorphinan-3-ol | ChemIDplus |
| 21-cyclopropyl-7α-[(S)-1-hydroxy-1,2,2-trimethylpropyl]-6,14-endo-ethano-6,7,8,14-tetrahydrooripavine | ChemIDplus |
| 2-[3-cyclopropylmethyl-11-hydroxy-15-methoxy-(14R)-13-oxa-3-azahexacyclo[13.2.2.12,8.01,6.06,14.07,12]icosa-7,9,11-trien-16-yl]-3,3-dimethyl-2-butanol | ChEMBL |
| 2-(N-cyclopropylmethyl-4,5α-epoxy-3-hydroxy-6-methoxy-6,14-endo-ethanomorphinan-6α-yl)-3,3-dimethyl-2-butanol | ChemIDplus |
| (−)-buprenorphine | ChEBI |
| Buprenorphine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6182863 | Beilstein |
| CAS:52485-79-7 | ChemIDplus |
| CAS:52485-79-7 | KEGG COMPOUND |
| CAS:52485-79-7 | NIST Chemistry WebBook |
| Citations |
|---|