EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H19Cl3O8 |
| Net Charge | 0 |
| Average Mass | 397.635 |
| Monoisotopic Mass | 396.01455 |
| SMILES | OC[C@H]1O[C@H](O[C@]2(CCl)O[C@H](CCl)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1Cl |
| InChI | InChI=1S/C12H19Cl3O8/c13-1-4-7(17)10(20)12(3-14,22-4)23-11-9(19)8(18)6(15)5(2-16)21-11/h4-11,16-20H,1-3H2/t4-,5-,6+,7-,8+,9-,10+,11-,12+/m1/s1 |
| InChIKey | BAQAVOSOZGMPRM-QBMZZYIRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | sweetening agent Substance that sweeten food, beverages, medications, etc. environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | sweetening agent Substance that sweeten food, beverages, medications, etc. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sucralose (CHEBI:32159) has role environmental contaminant (CHEBI:78298) |
| sucralose (CHEBI:32159) has role sweetening agent (CHEBI:50505) |
| sucralose (CHEBI:32159) has role xenobiotic (CHEBI:35703) |
| sucralose (CHEBI:32159) is a disaccharide derivative (CHEBI:63353) |
| sucralose (CHEBI:32159) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 1,6-dichloro-1,6-dideoxy-β-D-fructofuranosyl 4-chloro-4-deoxy-α-D-galactopyranoside |
| Synonym | Source |
|---|---|
| Trichlorosucrose | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C12285 | KEGG COMPOUND |
| HMDB0031554 | HMDB |
| Sucralose | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3654410 | Reaxys |
| CAS:56038-13-2 | KEGG COMPOUND |
| CAS:56038-13-2 | ChemIDplus |
| Citations |
|---|