EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42O7 |
| Net Charge | 0 |
| Average Mass | 514.659 |
| Monoisotopic Mass | 514.29305 |
| SMILES | C/C=C(C)/C=C/C=C/[C@H](OC)[C@@H](C)[C@@H](OC)[C@@H](C)CCc1oc2c(O)c(OC)cc(OC)c2c(=O)c1C |
| InChI | InChI=1S/C30H42O7/c1-10-18(2)13-11-12-14-22(33-6)21(5)29(36-9)19(3)15-16-23-20(4)27(31)26-24(34-7)17-25(35-8)28(32)30(26)37-23/h10-14,17,19,21-22,29,32H,15-16H2,1-9H3/b13-11+,14-12+,18-10+/t19-,21+,22-,29-/m0/s1 |
| InChIKey | UZHDGDDPOPDJGM-CVOZLMQJSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stigmatella aurantiaca Sg a15 (ncbitaxon:675526) | - | PubMed (18701458) |
| Roles Classification |
|---|
| Biological Roles: | quinol oxidation site inhibitor An compound that inhibits quinol oxidation sites. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stigmatellin A (CHEBI:32155) has role bacterial metabolite (CHEBI:76969) |
| stigmatellin A (CHEBI:32155) has role quinol oxidation site inhibitor (CHEBI:74352) |
| stigmatellin A (CHEBI:32155) is a aromatic ether (CHEBI:35618) |
| stigmatellin A (CHEBI:32155) is a chromones (CHEBI:23238) |
| stigmatellin A (CHEBI:32155) is a olefinic compound (CHEBI:78840) |
| stigmatellin A (CHEBI:32155) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2-[(3S,4S,5S,6S,7E,9E,11E)-4,6-dimethoxy-3,5,11-trimethyltrideca-7,9,11-trien-1-yl]-8-hydroxy-5,7-dimethoxy-3-methyl-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| Stigmatellin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00018584 | KNApSAcK |
| C12148 | KEGG COMPOUND |
| CPD0-1686 | MetaCyc |
| SMA | PDBeChem |
| Stigmatellin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8595371 | Reaxys |
| CAS:91682-96-1 | KEGG COMPOUND |
| CAS:91682-96-1 | ChemIDplus |
| Citations |
|---|