EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H13NO4 |
| Net Charge | 0 |
| Average Mass | 307.305 |
| Monoisotopic Mass | 307.08446 |
| SMILES | Cc1cc(O)c2c(c1)C(N)=C1C(=O)c3c(O)cccc3C(O)=C12 |
| InChI | InChI=1S/C18H13NO4/c1-7-5-9-12(11(21)6-7)14-15(16(9)19)18(23)13-8(17(14)22)3-2-4-10(13)20/h2-6,20-22H,19H2,1H3 |
| InChIKey | DEEIVBZXTPAXOC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces murayamaensis (ncbitaxon:224537) | - | PubMed (9531987) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stealthin C (CHEBI:32153) has role bacterial metabolite (CHEBI:76969) |
| stealthin C (CHEBI:32153) is a organic heterotetracyclic compound (CHEBI:38163) |
| stealthin C (CHEBI:32153) is a polyphenol (CHEBI:26195) |
| stealthin C (CHEBI:32153) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| 11-amino-4,5,9-trihydroxy-2-methyl-10H-benzo[b]fluoren-10-one |
| Synonym | Source |
|---|---|
| Stealthin C | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C12392 | KEGG COMPOUND |
| Citations |
|---|