EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H13NO8S2.2Na |
| Net Charge | 0 |
| Average Mass | 481.415 |
| Monoisotopic Mass | 480.98780 |
| SMILES | O=S(=O)([O-])Oc1ccc(C(c2ccc(OS(=O)(=O)[O-])cc2)c2ccccn2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C18H15NO8S2.2Na/c20-28(21,22)26-15-8-4-13(5-9-15)18(17-3-1-2-12-19-17)14-6-10-16(11-7-14)27-29(23,24)25;;/h1-12,18H,(H,20,21,22)(H,23,24,25);;/q;2*+1/p-2 |
| InChIKey | GOZDTZWAMGHLDY-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Application: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium picosulfate (CHEBI:32147) has role laxative (CHEBI:50503) |
| sodium picosulfate (CHEBI:32147) is a aryl sulfate (CHEBI:37919) |
| sodium picosulfate (CHEBI:32147) is a pyridines (CHEBI:26421) |
| INNs | Source |
|---|---|
| picosulfate de sodium | WHO MedNet |
| picosulfato de sodio | WHO MedNet |
| Synonyms | Source |
|---|---|
| DA 1773 | ChEMBL |
| DA-1773 | ChEMBL |
| Guttalax-fher | ChEMBL |
| LA 391 | ChEMBL |
| LA-391 | ChEMBL |
| Laxoberal | ChEMBL |
| Brand Names | Source |
|---|---|
| Citrafleet | ChEMBL |
| Dulcolax pico | ChEMBL |
| Otc concepts | ChEMBL |
| Picolax | ChEMBL |
| Sodium picosulfate component of clenpiq | ChEMBL |
| Sodium picosulfate component of prepopik | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| C13072 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:10040-45-6 | KEGG COMPOUND |
| Citations |
|---|