EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H67N5O6 |
| Net Charge | 0 |
| Average Mass | 701.994 |
| Monoisotopic Mass | 701.50913 |
| SMILES | [H][C@]([C@@H](C)CC)([C@@H](CC(=O)N1CCC[C@@]1([H])[C@H](OC)[C@@H](C)C(=O)NCCc1ccccc1)OC)N(C)C(=O)[C@@H](NC(=O)[C@H](C(C)C)N(C)C)C(C)C |
| InChI | InChI=1S/C39H67N5O6/c1-13-27(6)35(43(10)39(48)33(25(2)3)41-38(47)34(26(4)5)42(8)9)31(49-11)24-32(45)44-23-17-20-30(44)36(50-12)28(7)37(46)40-22-21-29-18-15-14-16-19-29/h14-16,18-19,25-28,30-31,33-36H,13,17,20-24H2,1-12H3,(H,40,46)(H,41,47)/t27-,28+,30-,31+,33-,34-,35-,36+/m0/s1 |
| InChIKey | DZMVCVHATYROOS-ZBFGKEHZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| soblidotin (CHEBI:32135) has functional parent L-valine (CHEBI:16414) |
| soblidotin (CHEBI:32135) has functional parent 2-phenylethylamine (CHEBI:18397) |
| soblidotin (CHEBI:32135) has role antineoplastic agent (CHEBI:35610) |
| soblidotin (CHEBI:32135) has role apoptosis inducer (CHEBI:68495) |
| soblidotin (CHEBI:32135) has role microtubule-destabilising agent (CHEBI:61951) |
| soblidotin (CHEBI:32135) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| N,N-dimethyl-L-valyl-N-{(3R,4S,5S)-3-methoxy-1-[(2S)-2-{(1R,2R)-1-methoxy-2-methyl-3-oxo-3-[(2-phenylethyl)amino]propyl}pyrrolidin-1-yl]-5-methyl-1-oxoheptan-4-yl}-N-methyl-L-valinamide |
| INNs | Source |
|---|---|
| soblidotin | WHO MedNet |
| soblidotina | WHO MedNet |
| soblidotinum | WHO MedNet |
| soblidotine | WHO MedNet |
| Synonyms | Source |
|---|---|
| TZT 1027 | ChemIDplus |
| TZT-1027 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:149606-27-9 | ChemIDplus |
| Citations |
|---|