EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26Cl2O6 |
| Net Charge | 0 |
| Average Mass | 469.361 |
| Monoisotopic Mass | 468.11064 |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)OCCCOC(=O)C(C)(C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H26Cl2O6/c1-22(2,30-18-10-6-16(24)7-11-18)20(26)28-14-5-15-29-21(27)23(3,4)31-19-12-8-17(25)9-13-19/h6-13H,5,14-15H2,1-4H3 |
| InChIKey | JLRNKCZRCMIVKA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Simfibrate (CHEBI:32131) has role cardiovascular drug (CHEBI:35554) |
| Simfibrate (CHEBI:32131) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| simfibrato | WHO MedNet |
| Synonyms | Source |
|---|---|
| cholesolvin | DrugCentral |
| clofibric acid trimethylene ester | DrugCentral |
| CLY-503 | ChEMBL |
| Simfibrate | KEGG COMPOUND |