EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32128 - Siccanin
| Formula | C22H30O3 |
| Net Charge | 0 |
| Average Mass | 342.479 |
| Monoisotopic Mass | 342.21949 |
| SMILES | [H][C@@]12[C@]34CCCC(C)(C)[C@]3([H])CC[C@]1(C)Oc1cc(C)cc(O)c1[C@]2([H])OC4 |
| InChI | InChI=1S/C22H30O3/c1-13-10-14(23)17-15(11-13)25-21(4)9-6-16-20(2,3)7-5-8-22(16)12-24-18(17)19(21)22/h10-11,16,18-19,23H,5-9,12H2,1-4H3/t16-,18-,19-,21-,22-/m0/s1 |
| InChIKey | UGGAILYEBCSZIV-ITJSPEIASA-N |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Siccanin (CHEBI:32128) has role antifungal drug (CHEBI:86327) |
| Siccanin (CHEBI:32128) has role fungal metabolite (CHEBI:76946) |
| Siccanin (CHEBI:32128) is a organic heteropentacyclic compound (CHEBI:38164) |
| Synonyms | Source |
|---|---|
| (-)-Siccanin | DrugCentral |
| Siccanin | KEGG COMPOUND |