EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O3 |
| Net Charge | 0 |
| Average Mass | 342.479 |
| Monoisotopic Mass | 342.21949 |
| SMILES | [H][C@@]12[C@]34CCCC(C)(C)[C@]3([H])CC[C@]1(C)Oc1cc(C)cc(O)c1[C@]2([H])OC4 |
| InChI | InChI=1S/C22H30O3/c1-13-10-14(23)17-15(11-13)25-21(4)9-6-16-20(2,3)7-5-8-22(16)12-24-18(17)19(21)22/h10-11,16,18-19,23H,5-9,12H2,1-4H3/t16-,18-,19-,21-,22-/m0/s1 |
| InChIKey | UGGAILYEBCSZIV-ITJSPEIASA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Siccanin (CHEBI:32128) has role antifungal drug (CHEBI:86327) |
| Siccanin (CHEBI:32128) has role fungal metabolite (CHEBI:76946) |
| Siccanin (CHEBI:32128) is a organic heteropentacyclic compound (CHEBI:38164) |
| Synonyms | Source |
|---|---|
| (-)-Siccanin | DrugCentral |
| Siccanin | KEGG COMPOUND |