EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C21H30NO4 |
| Net Charge | 0 |
| Average Mass | 440.378 |
| Monoisotopic Mass | 439.13582 |
| SMILES | CCCC[N+]1(C)[C@@H]2C[C@@H](OC(=O)[C@H](CO)c3ccccc3)C[C@H]1[C@@H]1O[C@@H]12.[Br-] |
| InChI | InChI=1S/C21H30NO4.BrH/c1-3-4-10-22(2)17-11-15(12-18(22)20-19(17)26-20)25-21(24)16(13-23)14-8-6-5-7-9-14;/h5-9,15-20,23H,3-4,10-13H2,1-2H3;1H/q+1;/p-1/t15-,16-,17-,18+,19-,20+,22?;/m1./s1 |
| InChIKey | HOZOZZFCZRXYEK-GSWUYBTGSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butylscopolamine bromide (CHEBI:32123) has part butylscopolamine (CHEBI:145701) |
| butylscopolamine bromide (CHEBI:32123) has role antispasmodic drug (CHEBI:53784) |
| butylscopolamine bromide (CHEBI:32123) has role muscarinic antagonist (CHEBI:48876) |
| butylscopolamine bromide (CHEBI:32123) is a organic bromide salt (CHEBI:48369) |
| butylscopolamine bromide (CHEBI:32123) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| (2R,4S,5S,7s)-9-butyl-7-{[(2S)-3-hydroxy-2-phenylpropanoyl]oxy}-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonane bromide |
| Synonyms | Source |
|---|---|
| butylscopolamine bromide | KEGG DRUG |
| butylscopolammonium bromide | ChemIDplus |
| N-butylhyoscine bromide | ChemIDplus |
| N-butylhyoscinium bromide | ChemIDplus |
| N-butylscopolamine bromide | ChemIDplus |
| N-butylscopolaminium bromide | ChemIDplus |
| Brand Names | Source |
|---|---|
| Amisepan | ChemIDplus |
| Antipan | ChEBI |
| Buscapina | ChemIDplus |
| Buscapine | ChemIDplus |
| Buscogast | ChEBI |
| Buscol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 458 | DrugCentral |
| D01451 | KEGG DRUG |
| DBSALT002585 | DrugBank |
| Hyoscine_butylbromide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:149-64-4 | ChemIDplus |
| Citations |
|---|