EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C21H30NO4 |
| Net Charge | 0 |
| Average Mass | 440.378 |
| Monoisotopic Mass | 439.13582 |
| SMILES | CCCC[N+]1(C)[C@@H]2C[C@@H](OC(=O)[C@H](CO)c3ccccc3)C[C@H]1[C@@H]1O[C@@H]12.[Br-] |
| InChI | InChI=1S/C21H30NO4.BrH/c1-3-4-10-22(2)17-11-15(12-18(22)20-19(17)26-20)25-21(24)16(13-23)14-8-6-5-7-9-14;/h5-9,15-20,23H,3-4,10-13H2,1-2H3;1H/q+1;/p-1/t15-,16-,17-,18+,19-,20+,22?;/m1./s1 |
| InChIKey | HOZOZZFCZRXYEK-GSWUYBTGSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butylscopolamine bromide (CHEBI:32123) has part butylscopolamine (CHEBI:145701) |
| butylscopolamine bromide (CHEBI:32123) has role antispasmodic drug (CHEBI:53784) |
| butylscopolamine bromide (CHEBI:32123) has role muscarinic antagonist (CHEBI:48876) |
| butylscopolamine bromide (CHEBI:32123) is a organic bromide salt (CHEBI:48369) |
| butylscopolamine bromide (CHEBI:32123) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| (2R,4S,5S,7s)-9-butyl-7-{[(2S)-3-hydroxy-2-phenylpropanoyl]oxy}-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonane bromide |
| Synonyms | Source |
|---|---|
| butylscopolamine bromide | KEGG DRUG |
| butylscopolammonium bromide | ChemIDplus |
| N-butylhyoscine bromide | ChemIDplus |
| N-butylhyoscinium bromide | ChemIDplus |
| N-butylscopolamine bromide | ChemIDplus |
| N-butylscopolaminium bromide | ChemIDplus |
| Brand Names | Source |
|---|---|
| Amisepan | ChemIDplus |
| Antipan | ChEBI |
| Buscapina | ChemIDplus |
| Buscapine | ChemIDplus |
| Buscogast | ChEBI |
| Buscol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 458 | DrugCentral |
| D01451 | KEGG DRUG |
| DBSALT002585 | DrugBank |
| Hyoscine_butylbromide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:149-64-4 | ChemIDplus |
| Citations |
|---|