EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15N5 |
| Net Charge | 0 |
| Average Mass | 157.221 |
| Monoisotopic Mass | 157.13275 |
| SMILES | CCCCNC(=N)NC(=N)N |
| InChI | InChI=1S/C6H15N5/c1-2-3-4-10-6(9)11-5(7)8/h2-4H2,1H3,(H6,7,8,9,10,11) |
| InChIKey | XSEUMFJMFFMCIU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. hypoglycemic agent A drug which lowers the blood glucose level. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| buformin (CHEBI:3209) has functional parent biguanide (CHEBI:3095) |
| buformin (CHEBI:3209) has role antineoplastic agent (CHEBI:35610) |
| buformin (CHEBI:3209) has role antiviral agent (CHEBI:22587) |
| buformin (CHEBI:3209) has role geroprotector (CHEBI:176497) |
| buformin (CHEBI:3209) has role hypoglycemic agent (CHEBI:35526) |
| buformin (CHEBI:3209) has role radiosensitizing agent (CHEBI:132992) |
| buformin (CHEBI:3209) is a biguanides (CHEBI:53662) |
| IUPAC Name |
|---|
| N-butyltriimidodicarbonic diamide |
| INNs | Source |
|---|---|
| buformin | WHO MedNet |
| buformina | WHO MedNet |
| buformine | WHO MedNet |
| buforminum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-butylbiguanide | ChemIDplus |
| 1-butyldiguanide | ChemIDplus |
| butformin | ChemIDplus |
| butylbiguanide | ChemIDplus |
| butyldiguanide | ChemIDplus |
| N-butyl-N'-(diaminomethylidene)guanidine | PDBeChem |
| Citations |
|---|