EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18ClN3O7 |
| Net Charge | 0 |
| Average Mass | 327.721 |
| Monoisotopic Mass | 327.08333 |
| SMILES | CO[C@H]1O[C@H](CNC(=O)N(CCCl)N=O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18ClN3O7/c1-20-9-8(17)7(16)6(15)5(21-9)4-12-10(18)14(13-19)3-2-11/h5-9,15-17H,2-4H2,1H3,(H,12,18)/t5-,6-,7+,8-,9+/m1/s1 |
| InChIKey | AHHFEZNOXOZZQA-ZEBDFXRSSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ranimustine (CHEBI:32089) has role antineoplastic agent (CHEBI:35610) |
| Ranimustine (CHEBI:32089) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| ranimustina | WHO MedNet |
| Synonyms | Source |
|---|---|
| cymerin | DrugCentral |
| cymerine | DrugCentral |
| NSC-270516 | ChEMBL |
| Ranimustine | KEGG COMPOUND |