EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21FN2O4S |
| Net Charge | 0 |
| Average Mass | 416.474 |
| Monoisotopic Mass | 416.12061 |
| SMILES | O=C(O)CCn1c2c(c3ccccc31)C[C@H](NS(=O)(=O)c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C21H21FN2O4S/c22-14-5-8-16(9-6-14)29(27,28)23-15-7-10-20-18(13-15)17-3-1-2-4-19(17)24(20)12-11-21(25)26/h1-6,8-9,15,23H,7,10-13H2,(H,25,26)/t15-/m1/s1 |
| InChIKey | LDXDSHIEDAPSSA-OAHLLOKOSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ramatroban (CHEBI:32087) has role anti-asthmatic agent (CHEBI:65023) |
| Ramatroban (CHEBI:32087) has role antiviral agent (CHEBI:22587) |
| Ramatroban (CHEBI:32087) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| baynas | DrugCentral |
| BAY-U-3405 | ChEMBL |
| EN-137774 | ChEMBL |
| Ramatroban | KEGG COMPOUND |
| Citations |
|---|