EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H40O22 |
| Net Charge | 0 |
| Average Mass | 788.661 |
| Monoisotopic Mass | 788.20112 |
| SMILES | O=c1c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C33H40O22/c34-6-15-19(41)23(45)26(48)31(50-15)54-29-24(46)20(42)17(8-36)52-33(29)55-30-25(47)21(43)16(7-35)51-32(30)53-28-22(44)18-13(40)4-10(37)5-14(18)49-27(28)9-1-2-11(38)12(39)3-9/h1-5,15-17,19-21,23-26,29-43,45-48H,6-8H2/t15-,16-,17-,19-,20-,21-,23+,24+,25+,26-,29-,30-,31+,32+,33+/m1/s1 |
| InChIKey | IQBMWEYFKNVACH-MEBVLIOMSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quercetin 3-O-β-D-glucosyl-(1→2)-β-D-glucosyl-(1→2)-β-D-glucoside (CHEBI:32083) has role hepatoprotective agent (CHEBI:62868) |
| quercetin 3-O-β-D-glucosyl-(1→2)-β-D-glucosyl-(1→2)-β-D-glucoside (CHEBI:32083) has role plant metabolite (CHEBI:76924) |
| quercetin 3-O-β-D-glucosyl-(1→2)-β-D-glucosyl-(1→2)-β-D-glucoside (CHEBI:32083) is a quercetin O-glucoside (CHEBI:64621) |
| quercetin 3-O-β-D-glucosyl-(1→2)-β-D-glucosyl-(1→2)-β-D-glucoside (CHEBI:32083) is a tetrahydroxyflavone (CHEBI:38684) |
| quercetin 3-O-β-D-glucosyl-(1→2)-β-D-glucosyl-(1→2)-β-D-glucoside (CHEBI:32083) is a trisaccharide derivative (CHEBI:63571) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-3-yl β-D-glucopyranosyl-(1→2)-β-D-glucopyranosyl-(1→2)-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| Quercetin 3-sophorotrioside | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C12668 | KEGG COMPOUND |
| LMPK12112105 | LIPID MAPS |
| C00005446 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7406582 | Reaxys |
| CAS:38681-85-5 | KEGG COMPOUND |
| Citations |
|---|