EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28O16 |
| Net Charge | 0 |
| Average Mass | 596.494 |
| Monoisotopic Mass | 596.13773 |
| SMILES | O=c1c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C26H28O16/c27-6-15-18(34)20(36)24(42-25-21(37)17(33)13(32)7-38-25)26(40-15)41-23-19(35)16-12(31)4-9(28)5-14(16)39-22(23)8-1-2-10(29)11(30)3-8/h1-5,13,15,17-18,20-21,24-34,36-37H,6-7H2/t13-,15-,17+,18-,20+,21-,24-,25+,26+/m1/s1 |
| InChIKey | NKFZLEYLWAFYEH-CJNLAGEVSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quercetin 3-O-[β-D-xylosyl-(1→2)-β-D-glucoside] (CHEBI:32081) has role antioxidant (CHEBI:22586) |
| quercetin 3-O-[β-D-xylosyl-(1→2)-β-D-glucoside] (CHEBI:32081) has role plant metabolite (CHEBI:76924) |
| quercetin 3-O-[β-D-xylosyl-(1→2)-β-D-glucoside] (CHEBI:32081) is a disaccharide derivative (CHEBI:63353) |
| quercetin 3-O-[β-D-xylosyl-(1→2)-β-D-glucoside] (CHEBI:32081) is a quercetin O-glucoside (CHEBI:64621) |
| quercetin 3-O-[β-D-xylosyl-(1→2)-β-D-glucoside] (CHEBI:32081) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-3-yl 2-O-β-D-xylopyranosyl-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-((2-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy)-4H-1-benzopyran-4-one | ChemIDplus |
| quercetin 3-sambubioside | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C12637 | KEGG COMPOUND |
| LMPK12112090 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4344863 | Reaxys |
| CAS:83048-35-5 | ChemIDplus |
| Citations |
|---|