EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H22O15 |
| Net Charge | 0 |
| Average Mass | 550.425 |
| Monoisotopic Mass | 550.09587 |
| SMILES | O=C(O)CC(=O)OC[C@H]1O[C@@H](Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H22O15/c25-9-4-12(28)17-13(5-9)37-22(8-1-2-10(26)11(27)3-8)23(19(17)33)39-24-21(35)20(34)18(32)14(38-24)7-36-16(31)6-15(29)30/h1-5,14,18,20-21,24-28,32,34-35H,6-7H2,(H,29,30)/t14-,18-,20+,21-,24+/m1/s1 |
| InChIKey | NBQPHANHNTWDML-UJKBSQBPSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quercetin 3-O-(6-O-malonyl-β-D-glucoside) (CHEBI:32080) has role metabolite (CHEBI:25212) |
| quercetin 3-O-(6-O-malonyl-β-D-glucoside) (CHEBI:32080) has role plant metabolite (CHEBI:76924) |
| quercetin 3-O-(6-O-malonyl-β-D-glucoside) (CHEBI:32080) is a malonate ester (CHEBI:38083) |
| quercetin 3-O-(6-O-malonyl-β-D-glucoside) (CHEBI:32080) is a monosaccharide derivative (CHEBI:63367) |
| quercetin 3-O-(6-O-malonyl-β-D-glucoside) (CHEBI:32080) is a quercetin O-glucoside (CHEBI:64621) |
| quercetin 3-O-(6-O-malonyl-β-D-glucoside) (CHEBI:32080) is a tetrahydroxyflavone (CHEBI:38684) |
| quercetin 3-O-(6-O-malonyl-β-D-glucoside) (CHEBI:32080) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-3-yl 6-O-(carboxyacetyl)-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Quercetin 3-(6''-malonylglucoside) | LIPID MAPS |
| Quercetin-3-O-(6''-malonylglucoside) | KEGG COMPOUND |
| Quercetin 3-O-malonylglucoside | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00005956 | KNApSAcK |
| C12638 | KEGG COMPOUND |
| HMDB0037368 | HMDB |
| LMPK12112139 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6625918 | Reaxys |
| CAS:96862-01-0 | KEGG COMPOUND |
| Citations |
|---|