EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32079 - pyrrolnitrin
| Formula | C10H6Cl2N2O2 |
| Net Charge | 0 |
| Average Mass | 257.076 |
| Monoisotopic Mass | 255.98063 |
| SMILES | O=[N+]([O-])c1c(Cl)cccc1-c1cncc1Cl |
| InChI | InChI=1S/C10H6Cl2N2O2/c11-8-3-1-2-6(10(8)14(15)16)7-4-13-5-9(7)12/h1-5,13H |
| InChIKey | QJBZDBLBQWFTPZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia pyrrocinia (ncbitaxon:60550) | - | PubMed (4955234) | |
| Pseudomonas stutzeri (ncbitaxon:316) | - | PubMed (23149469) | |
| Acinetobacter haemolyticus (ncbitaxon:29430) | - | PubMed (23990066) | Strain: A19 |
| Pseudomonas chlororaphis (ncbitaxon:587753) | |||
| - | PubMed (25679537) | Strain: PCL1606 | |
| - | PubMed (25901993) | Strain: PA23 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrrolnitrin (CHEBI:32079) has role antifungal drug (CHEBI:86327) |
| pyrrolnitrin (CHEBI:32079) has role bacterial metabolite (CHEBI:76969) |
| pyrrolnitrin (CHEBI:32079) is a C-nitro compound (CHEBI:35716) |
| pyrrolnitrin (CHEBI:32079) is a alkaloid (CHEBI:22315) |
| pyrrolnitrin (CHEBI:32079) is a monochlorobenzenes (CHEBI:83403) |
| pyrrolnitrin (CHEBI:32079) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole |
| INNs | Source |
|---|---|
| pyrrolnitrin | KEGG DRUG |
| pyrrolnitrinum | ChemIDplus |
| pirrolnitrina | ChemIDplus |
| pyrrolnitrine | ChemIDplus |
| Synonyms | Source |
|---|---|
| NSC 107654 | ChemIDplus |
| 3-Chloro-4-(3-chloro-2-nitrophenyl)pyrrole | ChemIDplus |
| 3-Chloro-4-(2'-nitro-3'-chlorophenyl)pyrrole | ChemIDplus |
| NSC-107654 | ChemIDplus |
| UniProt Name | Source |
|---|---|
| pyrrolnitrin | UniProt |
| Citations |
|---|