EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32079 - pyrrolnitrin
| Formula | C10H6Cl2N2O2 |
| Net Charge | 0 |
| Average Mass | 257.076 |
| Monoisotopic Mass | 255.98063 |
| SMILES | O=[N+]([O-])c1c(Cl)cccc1-c1cncc1Cl |
| InChI | InChI=1S/C10H6Cl2N2O2/c11-8-3-1-2-6(10(8)14(15)16)7-4-13-5-9(7)12/h1-5,13H |
| InChIKey | QJBZDBLBQWFTPZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acinetobacter haemolyticus (ncbitaxon:29430) | - | PubMed (23990066) | Strain: A19 |
| Burkholderia pyrrocinia (ncbitaxon:60550) | - | PubMed (4955234) | |
| Pseudomonas chlororaphis (ncbitaxon:587753) | |||
| - | PubMed (25679537) | Strain: PCL1606 | |
| - | PubMed (25901993) | Strain: PA23 | |
| Pseudomonas stutzeri (ncbitaxon:316) | - | PubMed (23149469) |
| Roles Classification |
|---|
| Biological Roles: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrrolnitrin (CHEBI:32079) has role antifungal drug (CHEBI:86327) |
| pyrrolnitrin (CHEBI:32079) has role bacterial metabolite (CHEBI:76969) |
| pyrrolnitrin (CHEBI:32079) is a C-nitro compound (CHEBI:35716) |
| pyrrolnitrin (CHEBI:32079) is a alkaloid (CHEBI:22315) |
| pyrrolnitrin (CHEBI:32079) is a monochlorobenzenes (CHEBI:83403) |
| pyrrolnitrin (CHEBI:32079) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| 3-chloro-4-(3-chloro-2-nitrophenyl)-1H-pyrrole |
| INNs | Source |
|---|---|
| pirrolnitrina | ChemIDplus |
| pyrrolnitrin | KEGG DRUG |
| pyrrolnitrine | ChemIDplus |
| pyrrolnitrinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-Chloro-4-(2'-nitro-3'-chlorophenyl)pyrrole | ChemIDplus |
| 3-Chloro-4-(3-chloro-2-nitrophenyl)pyrrole | ChemIDplus |
| NSC 107654 | ChemIDplus |
| NSC-107654 | ChemIDplus |
| UniProt Name | Source |
|---|---|
| pyrrolnitrin | UniProt |
| Citations |
|---|