EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:32071 - Prulifloxacin
| Formula | C21H20FN3O6S |
| Net Charge | 0 |
| Average Mass | 461.471 |
| Monoisotopic Mass | 461.10568 |
| SMILES | Cc1oc(=O)oc1CN1CCN(c2cc3c(cc2F)c(=O)c(C(=O)O)c2n3C(C)S2)CC1 |
| InChI | InChI=1S/C21H20FN3O6S/c1-10-16(31-21(29)30-10)9-23-3-5-24(6-4-23)15-8-14-12(7-13(15)22)18(26)17(20(27)28)19-25(14)11(2)32-19/h7-8,11H,3-6,9H2,1-2H3,(H,27,28) |
| InChIKey | PWNMXPDKBYZCOO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antidiarrhoeal drug Any drug found useful in the symptomatic treatment of diarrhoea. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Prulifloxacin (CHEBI:32071) has role antibacterial agent (CHEBI:33282) |
| Prulifloxacin (CHEBI:32071) has role antidiarrhoeal drug (CHEBI:55323) |
| Prulifloxacin (CHEBI:32071) has role antiinfective agent (CHEBI:35441) |
| Prulifloxacin (CHEBI:32071) is a fluoroquinolone antibiotic (CHEBI:87211) |
| Prulifloxacin (CHEBI:32071) is a quinolone antibiotic (CHEBI:86324) |
| INNs | Source |
|---|---|
| prulifloxacine | WHO MedNet |
| prulifloxacino | WHO MedNet |
| Synonyms | Source |
|---|---|
| NM-441 | ChEMBL |
| NM441 | DrugCentral |
| NSC-759833 | ChEMBL |
| Prulifloxacin | KEGG COMPOUND |
| Pruvel | ChEMBL |
| Brand Name | Source |
|---|---|
| Sword | ChEMBL |
| Citations |
|---|