EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:32070 - Proxyphylline
| Formula | C10H14N4O3 |
| Net Charge | 0 |
| Average Mass | 238.247 |
| Monoisotopic Mass | 238.10659 |
| SMILES | CC(O)Cn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C10H14N4O3/c1-6(15)4-14-5-11-8-7(14)9(16)13(3)10(17)12(8)2/h5-6,15H,4H2,1-3H3 |
| InChIKey | KYHQZNGJUGFTGR-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Proxyphylline (CHEBI:32070) is a oxopurine (CHEBI:25810) |
| INN | Source |
|---|---|
| proxifilina | WHO MedNet |
| Synonyms | Source |
|---|---|
| beta-Hydroxypropyltheophylline | DrugCentral |
| hydroxypropyltheophylline | DrugCentral |
| monophylline | DrugCentral |
| NSC-163343 | ChEMBL |
| oxypropyltheophylline | DrugCentral |
| proxiphylline | DrugCentral |
| Brand Names | Source |
|---|---|
| Monophyllin | ChEMBL |
| Sigophyl | ChEMBL |
| Spantin | ChEMBL |
| Spasmolysin | ChEMBL |
| Thean | ChEMBL |
| Theoden | ChEMBL |
| Citations |
|---|