EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34O6 |
| Net Charge | 0 |
| Average Mass | 430.541 |
| Monoisotopic Mass | 430.23554 |
| SMILES | [H][C@@]12C[C@H]3OC(CCC)O[C@@]3(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C25H34O6/c1-4-5-21-30-20-11-17-16-7-6-14-10-15(27)8-9-23(14,2)22(16)18(28)12-24(17,3)25(20,31-21)19(29)13-26/h8-10,16-18,20-22,26,28H,4-7,11-13H2,1-3H3/t16-,17-,18-,20+,21?,22+,23-,24-,25+/m0/s1 |
| InChIKey | VOVIALXJUBGFJZ-KWVAZRHASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antiviral agent A substance that destroys or inhibits replication of viruses. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory drug A substance that reduces or suppresses inflammation. nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. anti-inflammatory agent Any compound that has anti-inflammatory effects. anti-asthmatic agent Any compound that has anti-asthmatic effects. anti-allergic agent A drug used to treat allergic reactions. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| budesonide (CHEBI:3207) has parent hydride pregnane (CHEBI:8386) |
| budesonide (CHEBI:3207) has role anti-allergic agent (CHEBI:50857) |
| budesonide (CHEBI:3207) has role anti-asthmatic agent (CHEBI:65023) |
| budesonide (CHEBI:3207) has role anti-inflammatory agent (CHEBI:67079) |
| budesonide (CHEBI:3207) has role anti-inflammatory drug (CHEBI:35472) |
| budesonide (CHEBI:3207) has role antineoplastic agent (CHEBI:35610) |
| budesonide (CHEBI:3207) has role antiviral agent (CHEBI:22587) |
| budesonide (CHEBI:3207) has role bronchodilator agent (CHEBI:35523) |
| budesonide (CHEBI:3207) has role drug allergen (CHEBI:88188) |
| budesonide (CHEBI:3207) has role nasal decongestant (CHEBI:77715) |
| budesonide (CHEBI:3207) is a 11β-hydroxy steroid (CHEBI:35346) |
| budesonide (CHEBI:3207) is a 20-oxo steroid (CHEBI:36885) |
| budesonide (CHEBI:3207) is a 21-hydroxy steroid (CHEBI:35344) |
| budesonide (CHEBI:3207) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| budesonide (CHEBI:3207) is a cyclic acetal (CHEBI:59770) |
| budesonide (CHEBI:3207) is a glucocorticoid (CHEBI:24261) |
| budesonide (CHEBI:3207) is a primary α-hydroxy ketone (CHEBI:139590) |
| IUPAC Name |
|---|
| 11β,21-dihydroxy-16α,17α-(butane-1,1-diyldioxy)pregna-1,4-diene-3,20-dione |
| INNs | Source |
|---|---|
| budesonida | WHO MedNet |
| budesonide | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (11β,16α)-16,17-(Butylidenebis(oxy))-11,21-dihydroxypregna-1,4-diene-3,20-dione | ChemIDplus |
| Eohilia | ChEMBL |
| MAP-0010 | ChEMBL |
| MAP0010 | ChEMBL |
| NSC-757788 | ChEMBL |
| R01AD05 | ChEMBL |
| Brand Names | Source |
|---|---|
| Aircort | ChEMBL |
| Budeflam aquanase | ChEMBL |
| Budelin novolizer | ChEMBL |
| Budenofalk | ChEMBL |
| Budesonide component of airsupra | ChEMBL |
| Budesonide component of breztri | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:51333-22-3 | ChemIDplus |
| CAS:51333-22-3 | KEGG DRUG |
| Citations |
|---|