EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34O6 |
| Net Charge | 0 |
| Average Mass | 430.541 |
| Monoisotopic Mass | 430.23554 |
| SMILES | [H][C@@]12C[C@H]3OC(CCC)O[C@@]3(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C25H34O6/c1-4-5-21-30-20-11-17-16-7-6-14-10-15(27)8-9-23(14,2)22(16)18(28)12-24(17,3)25(20,31-21)19(29)13-26/h8-10,16-18,20-22,26,28H,4-7,11-13H2,1-3H3/t16-,17-,18-,20+,21?,22+,23-,24-,25+/m0/s1 |
| InChIKey | VOVIALXJUBGFJZ-KWVAZRHASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. drug allergen Any drug which causes the onset of an allergic reaction. anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| budesonide (CHEBI:3207) has parent hydride pregnane (CHEBI:8386) |
| budesonide (CHEBI:3207) has role anti-inflammatory drug (CHEBI:35472) |
| budesonide (CHEBI:3207) has role bronchodilator agent (CHEBI:35523) |
| budesonide (CHEBI:3207) has role drug allergen (CHEBI:88188) |
| budesonide (CHEBI:3207) is a 11β-hydroxy steroid (CHEBI:35346) |
| budesonide (CHEBI:3207) is a 20-oxo steroid (CHEBI:36885) |
| budesonide (CHEBI:3207) is a 21-hydroxy steroid (CHEBI:35344) |
| budesonide (CHEBI:3207) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| budesonide (CHEBI:3207) is a cyclic acetal (CHEBI:59770) |
| budesonide (CHEBI:3207) is a glucocorticoid (CHEBI:24261) |
| budesonide (CHEBI:3207) is a primary α-hydroxy ketone (CHEBI:139590) |
| IUPAC Name |
|---|
| 11β,21-dihydroxy-16α,17α-(butane-1,1-diyldioxy)pregna-1,4-diene-3,20-dione |
| INN | Source |
|---|---|
| budesonide | KEGG DRUG |
| Synonym | Source |
|---|---|
| (11β,16α)-16,17-(Butylidenebis(oxy))-11,21-dihydroxypregna-1,4-diene-3,20-dione | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:51333-22-3 | KEGG DRUG |
| CAS:51333-22-3 | ChemIDplus |
| Citations |
|---|