EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N2S |
| Net Charge | 0 |
| Average Mass | 180.276 |
| Monoisotopic Mass | 180.07212 |
| SMILES | CCCc1cc(C(N)=S)ccn1 |
| InChI | InChI=1S/C9H12N2S/c1-2-3-8-6-7(9(10)12)4-5-11-8/h4-6H,2-3H2,1H3,(H2,10,12) |
| InChIKey | VRDIULHPQTYCLN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Prothionamide (CHEBI:32066) has role antitubercular agent (CHEBI:33231) |
| Prothionamide (CHEBI:32066) is a pyridines (CHEBI:26421) |
| INN | Source |
|---|---|
| protionamida | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-Propylisonicotinylthioamide | DrugCentral |
| 2-Propylthioisonicotinamide | DrugCentral |
| NSC-758962 | ChEMBL |
| prothionamide | DrugCentral |
| Prothionamide | KEGG COMPOUND |
| protionamid | DrugCentral |
| Brand Names | Source |
|---|---|
| Ektebin | ChEMBL |
| Peteha | ChEMBL |
| Trevintix | ChEMBL |
| Citations |
|---|