EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32058 - proglumide
| Formula | C18H26N2O4 |
| Net Charge | 0 |
| Average Mass | 334.416 |
| Monoisotopic Mass | 334.18926 |
| SMILES | CCCN(CCC)C(=O)C(CCC(=O)O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26N2O4/c1-3-12-20(13-4-2)18(24)15(10-11-16(21)22)19-17(23)14-8-6-5-7-9-14/h5-9,15H,3-4,10-13H2,1-2H3,(H,19,23)(H,21,22) |
| InChIKey | DGMKFQYCZXERLX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. delta-opioid receptor agonist A compound that exhibits agonist activity at the δ-opioid receptor. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. cholecystokinin antagonist A hormone antagonist that inhibits the action of the peptide hormone cholecystokinin. xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. |
| Applications: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. delta-opioid receptor agonist A compound that exhibits agonist activity at the δ-opioid receptor. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. cholecystokinin antagonist A hormone antagonist that inhibits the action of the peptide hormone cholecystokinin. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| proglumide (CHEBI:32058) has part (R)-proglumide (CHEBI:76267) |
| proglumide (CHEBI:32058) has part (S)-proglumide (CHEBI:76268) |
| proglumide (CHEBI:32058) has role anti-ulcer drug (CHEBI:49201) |
| proglumide (CHEBI:32058) has role cholecystokinin antagonist (CHEBI:73296) |
| proglumide (CHEBI:32058) has role cholinergic antagonist (CHEBI:48873) |
| proglumide (CHEBI:32058) has role drug metabolite (CHEBI:49103) |
| proglumide (CHEBI:32058) has role gastrointestinal drug (CHEBI:55324) |
| proglumide (CHEBI:32058) has role opioid analgesic (CHEBI:35482) |
| proglumide (CHEBI:32058) has role xenobiotic metabolite (CHEBI:76206) |
| proglumide (CHEBI:32058) has role δ-opioid receptor agonist (CHEBI:64054) |
| proglumide (CHEBI:32058) is a racemate (CHEBI:60911) |
| Incoming Relation(s) |
| proglumetacin (CHEBI:76263) has functional parent proglumide (CHEBI:32058) |
| IUPAC Name |
|---|
| rac-N2-benzoyl-N,N-dipropyl-α-glutamine |
| INNs | Source |
|---|---|
| proglumida | ChemIDplus |
| proglumide | KEGG DRUG |
| proglumide | WHO MedNet |
| proglumidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (±)-4-benzamido-N,N-dipropylglutaramic acid | ChemIDplus |
| (RS)-proglumide | ChEBI |
| (±)-proglumide | ChEBI |
| racemic proglumide | ChEBI |
| DL-proglumide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2281 | DrugCentral |
| D01818 | KEGG DRUG |
| LSM-4439 | LINCS |
| Proglumide | Wikipedia |
| WO2005011665 | Patent |
| WO2005041963 | Patent |
| WO2005044248 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4151696 | Reaxys |
| CAS:6620-60-6 | ChemIDplus |
| CAS:6620-60-6 | KEGG DRUG |
| Citations |
|---|