EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26N2O4 |
| Net Charge | 0 |
| Average Mass | 334.416 |
| Monoisotopic Mass | 334.18926 |
| SMILES | CCCN(CCC)C(=O)C(CCC(=O)O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26N2O4/c1-3-12-20(13-4-2)18(24)15(10-11-16(21)22)19-17(23)14-8-6-5-7-9-14/h5-9,15H,3-4,10-13H2,1-2H3,(H,19,23)(H,21,22) |
| InChIKey | DGMKFQYCZXERLX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | delta-opioid receptor agonist A compound that exhibits agonist activity at the δ-opioid receptor. cholecystokinin antagonist A hormone antagonist that inhibits the action of the peptide hormone cholecystokinin. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. |
| Applications: | delta-opioid receptor agonist A compound that exhibits agonist activity at the δ-opioid receptor. cholecystokinin antagonist A hormone antagonist that inhibits the action of the peptide hormone cholecystokinin. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| proglumide (CHEBI:32058) has part (R)-proglumide (CHEBI:76267) |
| proglumide (CHEBI:32058) has part (S)-proglumide (CHEBI:76268) |
| proglumide (CHEBI:32058) has role anti-ulcer drug (CHEBI:49201) |
| proglumide (CHEBI:32058) has role cholecystokinin antagonist (CHEBI:73296) |
| proglumide (CHEBI:32058) has role cholinergic antagonist (CHEBI:48873) |
| proglumide (CHEBI:32058) has role drug metabolite (CHEBI:49103) |
| proglumide (CHEBI:32058) has role gastrointestinal drug (CHEBI:55324) |
| proglumide (CHEBI:32058) has role opioid analgesic (CHEBI:35482) |
| proglumide (CHEBI:32058) has role xenobiotic metabolite (CHEBI:76206) |
| proglumide (CHEBI:32058) has role δ-opioid receptor agonist (CHEBI:64054) |
| proglumide (CHEBI:32058) is a racemate (CHEBI:60911) |
| Incoming Relation(s) |
| proglumetacin (CHEBI:76263) has functional parent proglumide (CHEBI:32058) |
| IUPAC Name |
|---|
| rac-N2-benzoyl-N,N-dipropyl-α-glutamine |
| INNs | Source |
|---|---|
| proglumida | ChemIDplus |
| proglumide | KEGG DRUG |
| proglumide | WHO MedNet |
| proglumidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (±)-4-benzamido-N,N-dipropylglutaramic acid | ChemIDplus |
| (RS)-proglumide | ChEBI |
| (±)-proglumide | ChEBI |
| racemic proglumide | ChEBI |
| DL-proglumide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2281 | DrugCentral |
| D01818 | KEGG DRUG |
| LSM-4439 | LINCS |
| Proglumide | Wikipedia |
| WO2005011665 | Patent |
| WO2005041963 | Patent |
| WO2005044248 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4151696 | Reaxys |
| CAS:6620-60-6 | ChemIDplus |
| CAS:6620-60-6 | KEGG DRUG |
| Citations |
|---|