EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H58ClN5O8.2C4H4O4 |
| Net Charge | 0 |
| Average Mass | 1076.594 |
| Monoisotopic Mass | 1075.41931 |
| SMILES | CCCN(CCC)C(=O)C(CCC(=O)OCCCN1CCN(CCOC(=O)Cc2c(C)n(C(=O)c3ccc(Cl)cc3)c3ccc(OC)cc23)CC1)NC(=O)c1ccccc1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C46H58ClN5O8.2C4H4O4/c1-5-21-51(22-6-2)46(57)40(48-44(55)34-11-8-7-9-12-34)18-20-42(53)59-29-10-23-49-24-26-50(27-25-49)28-30-60-43(54)32-38-33(3)52(41-19-17-37(58-4)31-39(38)41)45(56)35-13-15-36(47)16-14-35;2*5-3(6)1-2-4(7)8/h7-9,11-17,19,31,40H,5-6,10,18,20-30,32H2,1-4H3,(H,48,55);2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | MKFWBVKQDGNXDW-SPIKMXEPSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| proglumetacin dimaleate (CHEBI:32057) has part proglumetacin (CHEBI:76263) |
| proglumetacin dimaleate (CHEBI:32057) has role antipyretic (CHEBI:35493) |
| proglumetacin dimaleate (CHEBI:32057) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| proglumetacin dimaleate (CHEBI:32057) has role lipoxygenase inhibitor (CHEBI:35856) |
| proglumetacin dimaleate (CHEBI:32057) has role non-narcotic analgesic (CHEBI:35481) |
| proglumetacin dimaleate (CHEBI:32057) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| proglumetacin dimaleate (CHEBI:32057) is a maleate salt (CHEBI:50221) |
| IUPAC Name |
|---|
| 3-[4-(2-{2-[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetoxy}ethyl)piperazin-1-yl]propyl N2-benzoyl-N,N-dipropyl-α-glutaminate di[(2Z)-but-2-enedioate] |
| Synonym | Source |
|---|---|
| Proglumetacin maleate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Miridacin | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D01765 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15391370 | Reaxys |
| CAS:59209-40-4 | ChemIDplus |
| CAS:59209-40-4 | KEGG DRUG |
| Citations |
|---|