EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26N6O |
| Net Charge | 0 |
| Average Mass | 426.524 |
| Monoisotopic Mass | 426.21681 |
| SMILES | CCCc1nc2c(n1Cc1ccc(-c3ccccc3-c3nnnn3)cc1)C(=O)CCCC2 |
| InChI | InChI=1S/C25H26N6O/c1-2-7-23-26-21-10-5-6-11-22(32)24(21)31(23)16-17-12-14-18(15-13-17)19-8-3-4-9-20(19)25-27-29-30-28-25/h3-4,8-9,12-15H,2,5-7,10-11,16H2,1H3,(H,27,28,29,30) |
| InChIKey | KCTFTBCZZUBAKN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pratosartan (CHEBI:32041) has role antihypertensive agent (CHEBI:35674) |
| pratosartan (CHEBI:32041) is a biphenylyltetrazole (CHEBI:48420) |
| IUPAC Name |
|---|
| 2-propyl-3-{[2'-(1H-tetrazol-5-yl)biphenyl-4-yl]methyl}-5,6,7,8-tetrahydrocyclohepta[d]imidazol-4(3H)-one |
| INN | Source |
|---|---|
| pratosartan | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-propyl-3-((2'-(1H-tetrazol-5-yl)biphenyl-4-yl)methyl)-5,6,7,8-tetrahydrocycloheptaimidazol-4(3H)-one | ChemIDplus |
| KD 3-671 | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D01922 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8171170 | Beilstein |
| CAS:153804-05-8 | ChemIDplus |