EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13NO3 |
| Net Charge | 0 |
| Average Mass | 255.273 |
| Monoisotopic Mass | 255.08954 |
| SMILES | CC(C(=O)O)c1ccc2c(c1)Cc1cccnc1O2 |
| InChI | InChI=1S/C15H13NO3/c1-9(15(17)18)10-4-5-13-12(7-10)8-11-3-2-6-16-14(11)19-13/h2-7,9H,8H2,1H3,(H,17,18) |
| InChIKey | TVQZAMVBTVNYLA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pranoprofen (CHEBI:32040) has role ophthalmology drug (CHEBI:66981) |
| Pranoprofen (CHEBI:32040) is a pyridochromene (CHEBI:53792) |
| INNs | Source |
|---|---|
| pranoprofene | WHO MedNet |
| pranoprofeno | WHO MedNet |
| Synonyms | Source |
|---|---|
| dl-Pranoprofen | DrugCentral |
| Elicapric | ChEMBL |
| niflan | DrugCentral |
| NSC-759832 | ChEMBL |
| oftalar | DrugCentral |
| Pranoprofen | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2238 | DrugCentral |
| D01578 | KEGG DRUG |
| HMDB0041996 | HMDB |
| LSM-5110 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:52549-17-4 | KEGG COMPOUND |
| CAS:52549-17-4 | DrugCentral |
| Citations |
|---|