EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32033 - potassium 4-hydroxy-3-methoxybenzene-1-sulfonate
| Formula | C7H7O5S.K |
| Net Charge | 0 |
| Average Mass | 242.293 |
| Monoisotopic Mass | 241.96513 |
| SMILES | COc1cc(S(=O)(=O)[O-])ccc1O.[K+] |
| InChI | InChI=1S/C7H8O5S.K/c1-12-7-4-5(13(9,10)11)2-3-6(7)8;/h2-4,8H,1H3,(H,9,10,11);/q;+1/p-1 |
| InChIKey | QFRKWSPTCBGLSU-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | expectorant Compounds that are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing. Compare with mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration, and antitussives, which suppress the cough reflex. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| potassium 4-hydroxy-3-methoxybenzene-1-sulfonate (CHEBI:32033) has part 4-hydroxy-3-methoxybenzene-1-sulfonate (CHEBI:85539) |
| potassium 4-hydroxy-3-methoxybenzene-1-sulfonate (CHEBI:32033) has role expectorant (CHEBI:77035) |
| potassium 4-hydroxy-3-methoxybenzene-1-sulfonate (CHEBI:32033) is a organosulfonate salt (CHEBI:64382) |
| potassium 4-hydroxy-3-methoxybenzene-1-sulfonate (CHEBI:32033) is a potassium salt (CHEBI:26218) |
| IUPAC Name |
|---|
| potassium 4-hydroxy-3-methoxybenzene-1-sulfonate |
| Synonyms | Source |
|---|---|
| Potassium guaiacolsulfonate | KEGG DRUG |
| Sulfogaiacol | KEGG DRUG |
| potassium 4-hydroxy-3-methoxybenzenesulfonate | ChEBI |
| Potassium 4-guaiacolsulfonate | ChemIDplus |
| 4-Hydroxy-3-methyoxybenzenesulfonic acid, potassium salt | ChemIDplus |
| Monopotassium 4-hydroxy-3-methoxybenzenesulfonate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01610 | KEGG DRUG |
| US2008085312 | Patent |
| US2010041759 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3764215 | Reaxys |
| CAS:1321-14-8 | KEGG DRUG |
| CAS:16241-25-1 | ChemIDplus |
| Citations |
|---|