EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H3O2.K |
| Net Charge | 0 |
| Average Mass | 98.142 |
| Monoisotopic Mass | 97.97701 |
| SMILES | CC(=O)[O-].[K+] |
| InChI | InChI=1S/C2H4O2.K/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
| InChIKey | SCVFZCLFOSHCOH-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Application: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| potassium acetate (CHEBI:32029) has part acetate (CHEBI:30089) |
| potassium acetate (CHEBI:32029) has role food acidity regulator (CHEBI:64049) |
| potassium acetate (CHEBI:32029) is a potassium salt (CHEBI:26218) |
| IUPAC Name |
|---|
| potassium acetate |
| Synonyms | Source |
|---|---|
| AcOK | ChEBI |
| CH3CO2K | ChEBI |
| E261 | ChEBI |
| Kaliumazetat | ChEBI |
| KOAc | ChEBI |
| MeCO2K | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C12554 | KEGG COMPOUND |
| D01154 | KEGG DRUG |
| Potassium_Acetate | Wikipedia |