EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C2H4O)n.C18H36O2 |
| Net Charge | 0 |
| Average Mass | 328.537 |
| Monoisotopic Mass | 328.29775 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCCO |
| InChI | InChI=1S/C20H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)23-19-18-21/h21H,2-19H2,1H3 |
| InChIKey | RFVNOJDQRGSOEL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | emulsifier The chemical role played by a substance that stabilizes an emulsion by increasing its kinetic stability. food emulsifier A food additive used to form or maintain a uniform emulsion of two (or more) phases in a food. nonionic surfactant A surfactant with an uncharged hydrophilic headgroup. |
| Biological Role: | food emulsifier A food additive used to form or maintain a uniform emulsion of two (or more) phases in a food. |
| Application: | food emulsifier A food additive used to form or maintain a uniform emulsion of two (or more) phases in a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| polyoxyl 40 stearate (CHEBI:32027) has role emulsifier (CHEBI:63046) |
| polyoxyl 40 stearate (CHEBI:32027) has role food emulsifier (CHEBI:63047) |
| polyoxyl 40 stearate (CHEBI:32027) has role nonionic surfactant (CHEBI:38828) |
| polyoxyl 40 stearate (CHEBI:32027) is a hydroxypolyether (CHEBI:46792) |
| polyoxyl 40 stearate (CHEBI:32027) is a octadecanoate ester (CHEBI:75925) |
| IUPAC Name |
|---|
| α-octadecanoyl-ω-hydroxypoly(oxyethane-1,2-diyl) |
| Synonyms | Source |
|---|---|
| E431 | ChEBI |
| macrogol 40 stearate | ChemIDplus |
| macrogol stearate 2000 | ChemIDplus |
| PEG stearate | ChemIDplus |
| polyethylene glycol monostearate | ChemIDplus |
| polyethylene glycol stearate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Myrj 49 | ChemIDplus |
| Myrj 52 | KEGG DRUG |
| Myrj S40 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D01542 | KEGG DRUG |
| FDB010109 | FooDB |
| HMDB0032477 | HMDB |
| Polyoxyethylene_stearate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:9004-99-3 | ChemIDplus |
| Citations |
|---|