EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32023 - plaunotol
| Formula | C20H34O2 |
| Net Charge | 0 |
| Average Mass | 306.490 |
| Monoisotopic Mass | 306.25588 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(=C/CC/C(C)=C/CO)CO |
| InChI | InChI=1S/C20H34O2/c1-17(2)8-5-9-18(3)10-6-12-20(16-22)13-7-11-19(4)14-15-21/h8,10,13-14,21-22H,5-7,9,11-12,15-16H2,1-4H3/b18-10+,19-14+,20-13- |
| InChIKey | SUWYPNNPLSRNPS-UNTSEYQFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Croton stellatopilosus (ncbitaxon:431156) | leaf (BTO:0000713) | PubMed (24286075) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. nephroprotective agent Any protective agent that is able to prevent damage to the kidney. vulnerary A drug used in treating and healing of wounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| plaunotol (CHEBI:32023) has role anti-ulcer drug (CHEBI:49201) |
| plaunotol (CHEBI:32023) has role antibacterial agent (CHEBI:33282) |
| plaunotol (CHEBI:32023) has role antineoplastic agent (CHEBI:35610) |
| plaunotol (CHEBI:32023) has role apoptosis inducer (CHEBI:68495) |
| plaunotol (CHEBI:32023) has role nephroprotective agent (CHEBI:76595) |
| plaunotol (CHEBI:32023) has role plant metabolite (CHEBI:76924) |
| plaunotol (CHEBI:32023) has role vulnerary (CHEBI:73336) |
| plaunotol (CHEBI:32023) is a diterpenoid (CHEBI:23849) |
| plaunotol (CHEBI:32023) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| (2Z,6E)-2-[(3E)-4,8-dimethylnona-3,7-dien-1-yl]-6-methylocta-2,6-diene-1,8-diol |
| Synonyms | Source |
|---|---|
| (E,Z,E)-7-Hydroxymethyl-3,11,15-trimethyl-2,6,10,14-hexadecatetraen-1-ol | ChemIDplus |
| Plaunotolum | ChemIDplus |
| Kelnac | KEGG DRUG |
| 18-Hydroxygeranylgeraniol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| plaunotol | UniProt |
| Citations |
|---|