EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32023 - plaunotol
| Formula | C20H34O2 |
| Net Charge | 0 |
| Average Mass | 306.490 |
| Monoisotopic Mass | 306.25588 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(=C/CC/C(C)=C/CO)CO |
| InChI | InChI=1S/C20H34O2/c1-17(2)8-5-9-18(3)10-6-12-20(16-22)13-7-11-19(4)14-15-21/h8,10,13-14,21-22H,5-7,9,11-12,15-16H2,1-4H3/b18-10+,19-14+,20-13- |
| InChIKey | SUWYPNNPLSRNPS-UNTSEYQFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Croton stellatopilosus (ncbitaxon:431156) | leaf (BTO:0000713) | PubMed (24286075) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | vulnerary A drug used in treating and healing of wounds. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. nephroprotective agent Any protective agent that is able to prevent damage to the kidney. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| plaunotol (CHEBI:32023) has role anti-ulcer drug (CHEBI:49201) |
| plaunotol (CHEBI:32023) has role antibacterial agent (CHEBI:33282) |
| plaunotol (CHEBI:32023) has role antineoplastic agent (CHEBI:35610) |
| plaunotol (CHEBI:32023) has role apoptosis inducer (CHEBI:68495) |
| plaunotol (CHEBI:32023) has role nephroprotective agent (CHEBI:76595) |
| plaunotol (CHEBI:32023) has role plant metabolite (CHEBI:76924) |
| plaunotol (CHEBI:32023) has role vulnerary (CHEBI:73336) |
| plaunotol (CHEBI:32023) is a diterpenoid (CHEBI:23849) |
| plaunotol (CHEBI:32023) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| (2Z,6E)-2-[(3E)-4,8-dimethylnona-3,7-dien-1-yl]-6-methylocta-2,6-diene-1,8-diol |
| Synonyms | Source |
|---|---|
| 18-Hydroxygeranylgeraniol | KEGG COMPOUND |
| (E,Z,E)-7-Hydroxymethyl-3,11,15-trimethyl-2,6,10,14-hexadecatetraen-1-ol | ChemIDplus |
| Kelnac | KEGG DRUG |
| Plaunotolum | ChemIDplus |
| UniProt Name | Source |
|---|---|
| plaunotol | UniProt |
| Citations |
|---|