EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N4O3 |
| Net Charge | 0 |
| Average Mass | 288.307 |
| Monoisotopic Mass | 288.12224 |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cnc(N3CCCC3)nc21 |
| InChI | InChI=1S/C14H16N4O3/c1-2-17-8-10(13(20)21)11(19)9-7-15-14(16-12(9)17)18-5-3-4-6-18/h7-8H,2-6H2,1H3,(H,20,21) |
| InChIKey | RCIMBBZXSXFZBV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piromidic acid (CHEBI:32019) has role antibacterial drug (CHEBI:36047) |
| piromidic acid (CHEBI:32019) has role DNA synthesis inhibitor (CHEBI:59517) |
| piromidic acid (CHEBI:32019) is a monocarboxylic acid (CHEBI:25384) |
| piromidic acid (CHEBI:32019) is a pyridopyrimidine (CHEBI:38932) |
| piromidic acid (CHEBI:32019) is a pyrrolidines (CHEBI:38260) |
| piromidic acid (CHEBI:32019) is a quinolone antibiotic (CHEBI:86324) |
| piromidic acid (CHEBI:32019) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 8-ethyl-5-oxo-2-(pyrrolidin-1-yl)-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylic acid |
| INNs | Source |
|---|---|
| acide piromidique | WHO MedNet |
| ácido piromídico | WHO MedNet |
| acidum piromidicum | WHO MedNet |
| piromidic acid | WHO MedNet |
| Synonyms | Source |
|---|---|
| 8-ethyl-5,8-dihydro-5-oxo-2-(1-pyrrolidinyl)pyrido(2,3-d)pyrimidine-6-carboxylic acid | ChemIDplus |
| pyromidic acid | DrugCentral |
| Brand Names | Source |
|---|---|
| Actrun C | ChemIDplus |
| Bactramyl | ChemIDplus |
| Enterol | ChemIDplus |
| Gastrurol | ChemIDplus |
| Panacid | KEGG DRUG |
| Reelon | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2209 | DrugCentral |
| D01431 | KEGG DRUG |
| LSM-5506 | LINCS |
| Piromidic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:625004 | Reaxys |
| CAS:19562-30-2 | ChemIDplus |
| CAS:19562-30-2 | DrugCentral |
| Citations |
|---|