EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11NO |
| Net Charge | 0 |
| Average Mass | 185.226 |
| Monoisotopic Mass | 185.08406 |
| SMILES | Cc1ccc(=O)n(-c2ccccc2)c1 |
| InChI | InChI=1S/C12H11NO/c1-10-7-8-12(14)13(9-10)11-5-3-2-4-6-11/h2-9H,1H3 |
| InChIKey | ISWRGOKTTBVCFA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antifibrotic agent Any agent which acts to reduce fibrosis. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pirfenidone (CHEBI:32016) has role antifibrotic agent (CHEBI:233423) |
| pirfenidone (CHEBI:32016) has role antipyretic (CHEBI:35493) |
| pirfenidone (CHEBI:32016) has role non-narcotic analgesic (CHEBI:35481) |
| pirfenidone (CHEBI:32016) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| pirfenidone (CHEBI:32016) is a pyridone (CHEBI:38183) |
| IUPAC Name |
|---|
| 5-methyl-1-phenylpyridin-2(1H)-one |
| INNs | Source |
|---|---|
| pirfenidona | ChemIDplus |
| pirfenidone | ChemIDplus |
| pirfenidone | KEGG DRUG |
| pirfenidonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| AMR 69 | ChemIDplus |
| AMR-69 | ChemIDplus |
| Pirfenidone | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Esbriet | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4224 | DrugCentral |
| D01583 | KEGG DRUG |
| LSM-4190 | LINCS |
| Pirfenidone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1526549 | Reaxys |
| CAS:53179-13-8 | ChemIDplus |
| CAS:53179-13-8 | KEGG DRUG |
| Citations |
|---|