EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11NO |
| Net Charge | 0 |
| Average Mass | 185.226 |
| Monoisotopic Mass | 185.08406 |
| SMILES | Cc1ccc(=O)n(-c2ccccc2)c1 |
| InChI | InChI=1S/C12H11NO/c1-10-7-8-12(14)13(9-10)11-5-3-2-4-6-11/h2-9H,1H3 |
| InChIKey | ISWRGOKTTBVCFA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. antifibrotic agent Any agent which acts to reduce fibrosis. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pirfenidone (CHEBI:32016) has role antifibrotic agent (CHEBI:233423) |
| pirfenidone (CHEBI:32016) has role antipyretic (CHEBI:35493) |
| pirfenidone (CHEBI:32016) has role non-narcotic analgesic (CHEBI:35481) |
| pirfenidone (CHEBI:32016) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| pirfenidone (CHEBI:32016) is a pyridone (CHEBI:38183) |
| IUPAC Name |
|---|
| 5-methyl-1-phenylpyridin-2(1H)-one |
| INNs | Source |
|---|---|
| pirfenidona | ChemIDplus |
| pirfenidone | ChemIDplus |
| pirfenidone | KEGG DRUG |
| pirfenidonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| AMR 69 | ChemIDplus |
| AMR-69 | ChemIDplus |
| Pirfenidone | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Esbriet | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4224 | DrugCentral |
| D01583 | KEGG DRUG |
| LSM-4190 | LINCS |
| Pirfenidone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1526549 | Reaxys |
| CAS:53179-13-8 | ChemIDplus |
| CAS:53179-13-8 | KEGG DRUG |
| Citations |
|---|