EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N2O5S |
| Net Charge | 0 |
| Average Mass | 362.407 |
| Monoisotopic Mass | 362.09364 |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)cc(N2CCCC2)c1Oc1ccccc1 |
| InChI | InChI=1S/C17H18N2O5S/c18-25(22,23)15-11-12(17(20)21)10-14(19-8-4-5-9-19)16(15)24-13-6-2-1-3-7-13/h1-3,6-7,10-11H,4-5,8-9H2,(H,20,21)(H2,18,22,23) |
| InChIKey | UJEWTUDSLQGTOA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Piretanide (CHEBI:32015) has role cardiovascular drug (CHEBI:35554) |
| Piretanide (CHEBI:32015) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| piretanida | WHO MedNet |
| Synonyms | Source |
|---|---|
| arelix | DrugCentral |
| diumax | DrugCentral |
| eurelix | DrugCentral |
| HOE 118 | ChEMBL |
| HOE-118 | ChEMBL |
| Piretanide | KEGG COMPOUND |
| Citations |
|---|