EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10N2O2 |
| Net Charge | 0 |
| Average Mass | 142.158 |
| Monoisotopic Mass | 142.07423 |
| SMILES | NC(=O)CN1CCCC1=O |
| InChI | InChI=1S/C6H10N2O2/c7-5(9)4-8-3-1-2-6(8)10/h1-4H2,(H2,7,9) |
| InChIKey | GMZVRMREEHBGGF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Piracetam (CHEBI:32010) has functional parent α-amino acid (CHEBI:33704) |
| Piracetam (CHEBI:32010) has role antidepressant (CHEBI:35469) |
| Piracetam (CHEBI:32010) has role antipsychotic agent (CHEBI:35476) |
| Piracetam (CHEBI:32010) has role anxiolytic drug (CHEBI:35474) |
| Piracetam (CHEBI:32010) is a organonitrogen compound (CHEBI:35352) |
| Piracetam (CHEBI:32010) is a organooxygen compound (CHEBI:36963) |
| Synonyms | Source |
|---|---|
| 2-Pyrrolidinoneacetamide | DrugCentral |
| CL-871 | ChEMBL |
| Myocalm | ChEMBL |
| neuracetam | DrugCentral |
| nootropil | DrugCentral |
| NSC-758191 | ChEMBL |
| Brand Names | Source |
|---|---|
| Gabacet | ChEMBL |
| Nootrop | ChEMBL |
| Nootrop 1200 | ChEMBL |
| Nootrop 400 | ChEMBL |
| Nootrop 800 | ChEMBL |
| Citations |
|---|