EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H42O12 |
| Net Charge | 0 |
| Average Mass | 618.676 |
| Monoisotopic Mass | 618.26763 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@@H](O[C@@H]4O[C@H](C)C[C@@H](OC(C)=O)[C@@H]4O)CC[C@]3(C=O)[C@@]1([H])[C@H](O)C(=O)[C@@]1(C)[C@]2(O)CC[C@]1([H])c1ccc(=O)oc1 |
| InChI | InChI=1S/C32H42O12/c1-16-12-22(43-17(2)34)25(36)28(42-16)44-19-6-9-30(15-33)24-21(7-10-31(30,39)13-19)32(40)11-8-20(18-4-5-23(35)41-14-18)29(32,3)27(38)26(24)37/h4-5,14-16,19-22,24-26,28,36-37,39-40H,6-13H2,1-3H3/t16-,19+,20-,21-,22-,24-,25+,26+,28+,29+,30+,31+,32+/m1/s1 |
| InChIKey | KWKQJZASURFCDP-ZPARAVGQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bryophyllum tubiflorum (ncbitaxon:84209) | - | PubMed (3439945) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bryotoxin A (CHEBI:3201) has functional parent bufanolide (CHEBI:22934) |
| bryotoxin A (CHEBI:3201) has role plant metabolite (CHEBI:76924) |
| bryotoxin A (CHEBI:3201) is a 11α-hydroxy steroid (CHEBI:19129) |
| bryotoxin A (CHEBI:3201) is a 14β-hydroxy steroid (CHEBI:36862) |
| bryotoxin A (CHEBI:3201) is a 19-oxo steroid (CHEBI:38149) |
| bryotoxin A (CHEBI:3201) is a 5β-hydroxy steroid (CHEBI:38195) |
| bryotoxin A (CHEBI:3201) is a bufadienolide glycoside (CHEBI:83971) |
| bryotoxin A (CHEBI:3201) is a monosaccharide derivative (CHEBI:63367) |
| bryotoxin A (CHEBI:3201) is a secondary α-hydroxy ketone (CHEBI:2468) |
| bryotoxin A (CHEBI:3201) is a steroid aldehyde (CHEBI:131565) |
| IUPAC Name |
|---|
| (3β,5β,11α)-3-[(3-O-acetyl-4,6-dideoxy-β-D-arabino-hexopyranosyl)oxy]-5,11,14-trihydroxy-12,19-dioxobufa-20,22-dienolide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7108097 | Reaxys |
| CAS:101329-50-4 | KEGG COMPOUND |
| CAS:101329-50-4 | ChemIDplus |
| Citations |
|---|