EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32004 - pipamperone dihydrochloride
| Formula | C21H30FN3O2.2HCl |
| Net Charge | 0 |
| Average Mass | 448.410 |
| Monoisotopic Mass | 447.18556 |
| SMILES | Cl.Cl.NC(=O)C1(N2CCCCC2)CCN(CCCC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H30FN3O2.2ClH/c22-18-8-6-17(7-9-18)19(26)5-4-12-24-15-10-21(11-16-24,20(23)27)25-13-2-1-3-14-25;;/h6-9H,1-5,10-16H2,(H2,23,27);2*1H |
| InChIKey | BMXXSXQVMCXGJM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | first generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be more likely than second generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements; such body movements can become permanent even after treatment has ceased. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pipamperone dihydrochloride (CHEBI:32004) has part pipamperone(2+) (CHEBI:78943) |
| pipamperone dihydrochloride (CHEBI:32004) has role dopaminergic antagonist (CHEBI:48561) |
| pipamperone dihydrochloride (CHEBI:32004) has role first generation antipsychotic (CHEBI:65190) |
| pipamperone dihydrochloride (CHEBI:32004) has role serotonergic antagonist (CHEBI:48279) |
| pipamperone dihydrochloride (CHEBI:32004) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1'-[4-(4-fluorophenyl)-4-oxobutyl]-1,4'-bipiperidine-4'-carboxamide dihydrochloride |
| Synonyms | Source |
|---|---|
| pipamperone hydrochloride | KEGG DRUG |
| 4'-carbamoyl-1'-[4-(4-fluorophenyl)-4-oxobutyl]-1,4'-bipiperidinium dichloride | IUPAC |
| p-fluoro-γ-(4-piperidino-4-carbamoylpiperidino)butyrophenone dihydrochloride | ChEBI |
| 1'-(3-(p-fluorobenzoyl)propyl)-(1,4'-bipiperidine)-4'-carboxamide dihydrochloride | ChEBI |
| Brand Names | Source |
|---|---|
| Piperonil | ChEBI |
| Dipiperon | ChEBI |
| Propitan | ChemIDplus |
| Citations |
|---|