EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N4O2 |
| Net Charge | 0 |
| Average Mass | 334.379 |
| Monoisotopic Mass | 334.14298 |
| SMILES | COc1ccc(-c2nc3ccc(C4=NNC(=O)CC4C)cc3n2)cc1 |
| InChI | InChI=1S/C19H18N4O2/c1-11-9-17(24)22-23-18(11)13-5-8-15-16(10-13)21-19(20-15)12-3-6-14(25-2)7-4-12/h3-8,10-11H,9H2,1-2H3,(H,20,21)(H,22,24) |
| InChIKey | GLBJJMFZWDBELO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.4.* (phosphoric diester hydrolase) inhibitor An EC 3.1.* (ester hydrolase) inhibitor that interferes with the action of a phosphoric diester hydrolase (EC 3.1.4.*). |
| Applications: | cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pimobendan (CHEBI:32003) has role cardiotonic drug (CHEBI:38147) |
| pimobendan (CHEBI:32003) has role EC 3.1.4.* (phosphoric diester hydrolase) inhibitor (CHEBI:50218) |
| pimobendan (CHEBI:32003) has role vasodilator agent (CHEBI:35620) |
| pimobendan (CHEBI:32003) is a benzimidazoles (CHEBI:22715) |
| pimobendan (CHEBI:32003) is a pyridazinone (CHEBI:26414) |
| IUPAC Name |
|---|
| 6-[2-(4-methoxyphenyl)-1H-benzimidazol-5-yl]-5-methyl-4,5-dihydropyridazin-3(2H)-one |
| INNs | Source |
|---|---|
| pimobendan | KEGG DRUG |
| pimobendane | ChemIDplus |
| pimobendanum | ChemIDplus |
| Synonym | Source |
|---|---|
| dl-Pimobendan | ChemIDplus |
| Brand Name | Source |
|---|---|
| Acardi | KEGG DRUG |